Chapter 10: Problem 58
The total number of functional group present in the following compound is
Short Answer
Expert verified
The total number of functional groups present in the given compound is 3, which includes 1 alcohol group (-OH), 1 ketone group (C=O), and 1 carboxylic acid group (-COOH). Therefore, the correct answer is (A) 3.
Step by step solution
01
Convert SMILES to molecular structure
First, let's convert the given SMILES string "CCCCCC(O)CC(=O)CC(Cl)C(=O)O" to a molecular structure. The structure is as follows:
```
O O
\ //
C - C - C
| \
C C - Cl
| ||
C - C - C
|
C - C - O
|
C
```
02
Identify the functional groups
Now let's identify the functional groups present in the compound. We can see the following functional groups:
1. An alcohol group (-OH) attached to the carbon chain.
2. A ketone group (C=O) linked to two other carbons.
3. A carboxylic acid group (-COOH) with a carbonyl group (C=O) and an hydroxyl group (-OH).
03
Count the functional groups
Now we will count the number of functional groups identified in the previous step:
1. There is one alcohol group (-OH) present in the compound.
2. There is one ketone group (C=O) present in the compound.
3. There is one carboxylic acid group (-COOH) present in the compound.
In total, there are 3 functional groups present in the compound.
04
Select the correct answer
Based on our analysis and the calculated total number of functional groups (3), the correct answer is:
(A) 3
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with Vaia!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
SMILES notation
SMILES, or Simplified Molecular Input Line Entry System, is a way to represent the structure of a molecule using a string of characters. This notation is widely used in chemistry because it is a concise and unambiguous way of describing a molecular structure. Each character or set of characters in SMILES corresponds to specific atoms and bonds in the molecule.
The example from the exercise, "CCCCCC(O)CC(=O)CC(Cl)C(=O)O", provides information about each part of the molecule:
Understanding SMILES is crucial as it allows chemists to easily share and store molecular information, perform computational analysis, and design new molecules.
The example from the exercise, "CCCCCC(O)CC(=O)CC(Cl)C(=O)O", provides information about each part of the molecule:
- 'C' represents carbon atoms arranged in a chain.
- 'O' represents an oxygen atom.
- '(=O)' denotes a double-bonded oxygen, indicative of certain functional groups like ketones and carboxylic acids.
- '(Cl)' indicates the presence of a chlorine atom connected to the carbon chain.
Understanding SMILES is crucial as it allows chemists to easily share and store molecular information, perform computational analysis, and design new molecules.
molecular structure conversion
Converting a SMILES string into a molecular structure involves visualizing the string's sequence as a 2D chemical structure diagram. This conversion is essential for identifying functional groups and understanding the compound's reactivity and properties.
In this process:
Through molecular structure conversion, we can accurately delineate molecular geometries which is further used for computational chemistry applications and functional group identification.
In this process:
- Carbon atoms (denoted by 'C') are connected in the sequence they appear, linked through single bonds unless a double bond '(=)' or triple bond '#' is specified.
- Atoms like oxygen (O), nitrogen (N), or halogens (e.g., Cl for chlorine) are attached to the appropriate carbons as depicted in the SMILES.
- Branches or rings are specified using parentheses, dictating the connectivity of different parts of the molecule.
Through molecular structure conversion, we can accurately delineate molecular geometries which is further used for computational chemistry applications and functional group identification.
organic chemistry functional groups
Functional groups are specific groups of atoms within molecules that have characteristic chemical behaviors. They are key components in organic chemistry because they largely determine the properties and reactions of organic compounds.
Common functional groups include:
Recognizing these groups in compounds allows chemists to predict chemical behavior, understand reactivity, and synthesize new materials effectively. This is why functional group identification is a critical skill in organic chemistry.
Common functional groups include:
- Alcohols (-OH), which feature a hydroxyl group bound to a saturated carbon atom.
- Ketones (C=O), with a carbonyl group attached to two carbon atoms.
- Carboxylic acids (-COOH), comprising a carbonyl bonded to an -OH, making them acidic.
Recognizing these groups in compounds allows chemists to predict chemical behavior, understand reactivity, and synthesize new materials effectively. This is why functional group identification is a critical skill in organic chemistry.
alcohol group
Alcohol functional groups contain an -OH (hydroxyl) group attached to a carbon atom. In organic chemistry, alcohols are classified based on the connectivity of the hydroxyl group:
Alcohols are crucial in many chemical reactions, such as dehydration (removing water) to form alkenes, or oxidation to form aldehydes, ketones, or carboxylic acids. They are also common in solvents and have been widely used in everyday products like sanitizers and fuels.
- Primary (1°) alcohols: the carbon with the -OH group is connected to only one other carbon.
- Secondary (2°) alcohols: the carbon with the -OH group is attached to two other carbons.
- Tertiary (3°) alcohols: the carbon with the -OH group is linked to three other carbon atoms.
Alcohols are crucial in many chemical reactions, such as dehydration (removing water) to form alkenes, or oxidation to form aldehydes, ketones, or carboxylic acids. They are also common in solvents and have been widely used in everyday products like sanitizers and fuels.
ketone group
Ketones are organic compounds characterized by the presence of a carbonyl group (C=O) flanked by two carbon atoms. This distinguishing feature lies within the molecule, making ketones different from aldehydes, which have the carbonyl at the end of the carbon chain.
The presence of the carbonyl group confers unique reactivity, allowing ketones to participate in nucleophilic addition reactions, where reagents add across the C=O bond.
Ketones are found in numerous natural and synthetic substances. They are often utilized in the production of resins, dyes, and fragrances, showcasing their versatility in various industrial applications. Understanding the properties and reactions of ketones is fundamental for students and chemists working in synthesis and molecular design.
The presence of the carbonyl group confers unique reactivity, allowing ketones to participate in nucleophilic addition reactions, where reagents add across the C=O bond.
Ketones are found in numerous natural and synthetic substances. They are often utilized in the production of resins, dyes, and fragrances, showcasing their versatility in various industrial applications. Understanding the properties and reactions of ketones is fundamental for students and chemists working in synthesis and molecular design.
carboxylic acid group
Carboxylic acids contain the carboxyl group (-COOH), which is composed of a carbonyl group (C=O) and an adjacent hydroxyl group (-OH) bonded to the same carbon. This arrangement imparts acidity due to the ability to donate an H+ ion from the -OH group in aqueous solutions.
They are commonly found in natural sources, such as in amino acids and fatty acids, and are also prevalent in industrial processes where they serve as starting materials for synthesis. Important reactions involving carboxylic acids include:
The understanding of carboxylic acids is essential for biochemistry and material science, highlighting the important role they play in biological systems and chemical manufacturing.
They are commonly found in natural sources, such as in amino acids and fatty acids, and are also prevalent in industrial processes where they serve as starting materials for synthesis. Important reactions involving carboxylic acids include:
- Esterification, where carboxylic acids react with alcohols to form esters.
- Acid-base reactions, where they react with bases to form carboxylate salts.
The understanding of carboxylic acids is essential for biochemistry and material science, highlighting the important role they play in biological systems and chemical manufacturing.