Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

When equal molar amounts of phthalic anhydride and 1,2,3-propanetriol are heated, they form an amorphous polyester. Under these conditions, polymerization is regioselective for the primary hydroxyl groups of the triol. (a) Draw a structural formula for the repeat unit of this polyester. (b) Account for the regioselective reaction with the primary hydroxyl groups only.

Short Answer

Expert verified
The repeat unit of the amorphous polyester formed from the reaction is O=C(OCH2CH(OH)CH2OH)C1=CC=CC=C1C(=O)O. The reaction occurs regioselectively with the primary hydroxyl groups only due to steric hindrance around the secondary hydroxyl group, making it less accessible to the phthalic anhydride for the reaction. The primary hydroxyl groups are more accessible and thus react preferentially, leading to this regioselective reaction.

Step by step solution

01

Identify the structure of the reactants

The two reactants are phthalic anhydride and 1,2,3-propanetriol. Their structures are as follows: Phthalic anhydride: OC(=O)C1=CC=CC=C1C(=O)O 1,2,3-propanetriol: HOCH2CH(OH)CH2OH
02

Draw the structural formula for the reaction

When the phthalic anhydride reacts with the 1,2,3-propanetriol, it will form an ester linkage between the carbonyl group of the anhydride and the primary hydroxyl group of the triol. The reaction is as follows: OC(=O)C1=CC=CC=C1C(=O)O + HOCH2CH(OH)CH2OH -> O=C(OCH2CH(OH)CH2OH)C1=CC=CC=C1C(=O)O + H2O
03

Determine the repeat unit of the polyester

The repeat unit of the polyester is the part of the polymer chain that is repeated over and over. In this case, the repeat unit contains the ester linkage and the parts of both reactants that form the polyester. The repeat unit is: O=C(OCH2CH(OH)CH2OH)C1=CC=CC=C1C(=O)O
04

Explain the regioselective reaction with the primary hydroxyl groups only

The regioselective reaction with the primary hydroxyl groups only means that the ester linkage is formed exclusively with the primary hydroxyl groups (the OH groups attached to the terminal carbons), and not with the secondary hydroxyl group (the OH group attached to the middle carbon). This is likely due to the steric hindrance around the secondary hydroxyl group, making it less accessible to the phthalic anhydride for the reaction. The primary hydroxyl groups are more accessible and thus react preferentially, leading to a regioselective reaction. In conclusion, the repeat unit of the polyester is O=C(OCH2CH(OH)CH2OH)C1=CC=CC=C1C(=O)O, and the reaction is regioselective for the primary hydroxyl groups only due to steric hindrance around the secondary hydroxyl group.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.

Sign-up for free