Chapter 22: Problem 15
Predict the major product or products from treatment of each compound with
\(\mathrm{HNO}_{3} / \mathrm{H}_{2} \mathrm{SO}_{4}\).
(a)
Short Answer
Expert verified
In a nitration reaction using a mixture of nitric acid (HNO3) and sulfuric acid (H2SO4), the major products for each reaction are as follows:
(a) COc1cccc([N+](=O)[O-])c1 -> COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]
(b) Cc1ccccc1[N+](=O)[O-] -> Cc1cc([N+](=O)[O-])ccc1[N+](=O)[O-] (ortho) and Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] (para)
(c) Cc1ccc(C)cc1 -> Cc1ccc(C)cc1[N+](=O)[O-]
(d) O=[N+]([O-])c1cccc2ccccc12 -> O=[N+]([O-])c1cccc(N(=O)=O)c1
Step by step solution
01
Identify the directing effect of the existing substituents
The given compound has two substituents on the aromatic ring: a methoxy group (OCH3) and a nitro group (NO2). A methoxy group is an electron-donating group (EDG) and has an activating effect on the ring, directing the incoming electrophile to the ortho and para positions. A nitro group is an electron-withdrawing group (EWG) and has a deactivating effect on the ring, directing the incoming electrophile to the meta position.
02
Predict the major product
Since the nitro group is already in the meta position with respect to the methoxy group, we expect the new nitro group to be added at the para position with respect to the methoxy group, as it has an activating effect. The predicted major product is:
COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] .
(b) Cc1ccccc1[N+](=O)[O-]
03
Identify the directing effect of the existing substituents
The given compound has a methyl group (CH3) and a nitro group (NO2) on the aromatic ring. The methyl group is an electron-donating group (EDG) and directs the incoming electrophile to the ortho and para positions. A nitro group is an electron-withdrawing group (EWG) and directs the incoming electrophile to the meta position.
04
Predict the major product
Since the EDG effect dominates, we expect the new nitro group to be added at the ortho and para positions with respect to the methyl group. The predicted major products are:
Cc1cc([N+](=O)[O-])ccc1[N+](=O)[O-] (ortho) and Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] (para).
(c) Cc1ccc(C)cc1
05
Identify the directing effect of the existing substituent
The given compound has two methyl groups (CH3) on the aromatic ring. Methyl groups are electron-donating groups (EDGs) and direct the incoming electrophile to the ortho and para positions.
06
Predict the major product
Since both methyl groups have the same directing effect, we expect the new nitro group to be added at the most available position, which is the para position with respect to both methyl groups. The predicted major product is:
Cc1ccc(C)cc1[N+](=O)[O-] .
(d) O=[N+]([O-])c1cccc2ccccc12
07
Identify the directing effect of the existing substituent
The given compound has a nitro group (NO2) on the aromatic ring. A nitro group is an electron-withdrawing group (EWG) and directs the incoming electrophile to the meta position.
08
Predict the major product
We expect the new nitro group to be added at the meta position with respect to the existing nitro group. The predicted major product is:
O=[N+]([O-])c1cccc(N(=O)=O)c1 .
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with Vaia!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Directing Effects of Substituents
When a chemical reaction involves an aromatic compound, the presence of substituents (groups attached to the benzene ring) can significantly influence the course of the reaction. This phenomenon is known as the 'directing effect of substituents'. Essentially, different substituents can dictate where on the aromatic ring a new group will be added during a reaction. For instance, some substituents make certain positions more reactive, guiding incoming groups to those spots.
The 'ortho', 'meta', and 'para' positions are terms commonly used to describe locations on the benzene ring relative to a substituent: 'ortho' means adjacent, 'meta' means one carbon away, and 'para' refers to the opposite side of the ring. Substituents can be broadly classified as either electron-donating or electron-withdrawing, and this nature affects their directing influence on the ring.
Understanding how substituents direct reactions is crucial for predicting the outcome of complex organic synthesis processes, where precision in the molecular structure is paramount. Electrophilic aromatic substitution reactions, for example, are heavily reliant on the directing effects to form the desired products.
The 'ortho', 'meta', and 'para' positions are terms commonly used to describe locations on the benzene ring relative to a substituent: 'ortho' means adjacent, 'meta' means one carbon away, and 'para' refers to the opposite side of the ring. Substituents can be broadly classified as either electron-donating or electron-withdrawing, and this nature affects their directing influence on the ring.
Understanding how substituents direct reactions is crucial for predicting the outcome of complex organic synthesis processes, where precision in the molecular structure is paramount. Electrophilic aromatic substitution reactions, for example, are heavily reliant on the directing effects to form the desired products.
Electron-Donating Groups
Electron-Donating Groups (EDGs) are substituents that push electron density onto an aromatic ring, enhancing its reactivity. Common examples include alkyl groups like methyl (CH3) and alkoxy groups like methoxy (OCH3). In organic chemistry, these groups are essentially 'helpers' that make the ring more appealing to electrophiles - particles or molecules seeking electrons.
EDGs activate the aromatic ring, making it more reactive towards electrophilic attack. They typically direct new groups to the ortho and para positions in electrophilic aromatic substitution reactions because these are the positions where electron density is increased. As a result, when an EDG is present, you'll often find that the major products have the new substituent at these locations.
This characteristic of electron-donating groups is essential when planning synthesis routes in organic chemistry, as it helps chemists control where modifications to a molecular structure will occur.
EDGs activate the aromatic ring, making it more reactive towards electrophilic attack. They typically direct new groups to the ortho and para positions in electrophilic aromatic substitution reactions because these are the positions where electron density is increased. As a result, when an EDG is present, you'll often find that the major products have the new substituent at these locations.
This characteristic of electron-donating groups is essential when planning synthesis routes in organic chemistry, as it helps chemists control where modifications to a molecular structure will occur.
Electron-Withdrawing Groups
In sharp contrast to electron-donating groups, Electron-Withdrawing Groups (EWGs) have an opposite effect on the aromatic ring. They pull electron density away from the ring, which makes it less reactive towards electrophiles. Some common EWGs include nitro (NO2), carbonyl (C=O), and cyano (CN) groups.
Because they deplete the ring of electrons, EWGs deactivate the aromatic ring, reducing its reactivity. They also shift the site of electrophilic attack to the meta position, rather than the ortho or para positions. This is due to the resonance structures of the intermediate carbocation formed during the reaction which shows a positive charge at the meta position when EWGs are present.
Recognizing the presence and influence of EWGs is vital for predicting the behavior of aromatic compounds in chemical reactions. Chemists use this knowledge to anticipate whether a certain transformation is feasible and what products are likely to form.
Because they deplete the ring of electrons, EWGs deactivate the aromatic ring, reducing its reactivity. They also shift the site of electrophilic attack to the meta position, rather than the ortho or para positions. This is due to the resonance structures of the intermediate carbocation formed during the reaction which shows a positive charge at the meta position when EWGs are present.
Recognizing the presence and influence of EWGs is vital for predicting the behavior of aromatic compounds in chemical reactions. Chemists use this knowledge to anticipate whether a certain transformation is feasible and what products are likely to form.
Nitration of Aromatic Compounds
Nitration is a classic example of electrophilic aromatic substitution where an aromatic compound reacts with nitric acid, usually in the presence of a strong acid like sulfuric acid, to introduce a nitro group (NO2) onto the ring. This process is integral in the synthesis of various industrial chemicals, explosives, and pharmaceuticals.
During nitration, the nitronium ion (NO2+) is the actual electrophile that attacks the aromatic ring. The reaction's outcome is heavily influenced by the directing effects of any substituents already present on the ring. A compound with EDGs will likely have the new nitro group land at ortho or para positions, in sharp contrast, EWGs would direct the new nitro group to a meta position.
Understanding nitration is of great importance in designing synthesis pathways for complex organic molecules. It serves as a stepping stone towards more sophisticated chemical constructs, showcasing how foundational concepts in chemistry are applied in real-world applications.
During nitration, the nitronium ion (NO2+) is the actual electrophile that attacks the aromatic ring. The reaction's outcome is heavily influenced by the directing effects of any substituents already present on the ring. A compound with EDGs will likely have the new nitro group land at ortho or para positions, in sharp contrast, EWGs would direct the new nitro group to a meta position.
Understanding nitration is of great importance in designing synthesis pathways for complex organic molecules. It serves as a stepping stone towards more sophisticated chemical constructs, showcasing how foundational concepts in chemistry are applied in real-world applications.