Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

When a \(1: 1\) mixture of ethyl propanoate and ethyl butanoate is treated with sodium ethoxide, four Claisen condensation products are possible. Draw a structural formula for each product.

Short Answer

Expert verified
Answer: The four Claisen condensation products have the following structural formulas: 1. CH3CH2C(O)CH2COOCH2CH3 2. CH3CH2C(O)CH2CH2COOCH2CH3 3. CH3CH2CH2C(O)CH2COOCH2CH3 4. CH3CH2CH2C(O)CH2CH2COOCH2CH3

Step by step solution

01

Identify the reactants

Ethyl propanoate (1) and ethyl butanoate (2) are the esters we are given. The structures of these reactants are as follows: Ethyl propanoate (1): CH3CH2COOCH2CH3 Ethyl butanoate (2): CH3CH2CH2COOCH2CH3 The base used in this reaction is sodium ethoxide (NaOCH2CH3).
02

Understand the Claisen condensation mechanism

The Claisen ester condensation is the reaction of two esters in the presence of a strong base, leading to the formation of a β-keto ester. In this process, one ester molecule acts as the nucleophile and attacks the carbonyl carbon of the other ester molecule, leading to the formation of a new C-C bond.
03

Determine the nucleophile and electrophile in the reaction

Since we have a 1:1 mixture of ethyl propanoate (1) and ethyl butanoate (2), there will be two different nucleophiles and electrophiles: Nucleophiles: - Ethyl propanoate (1): CH3CH2COO^- - Ethyl butanoate (2): CH3CH2CH2COO^- Electrophiles: - Ethyl propanoate (1): CH3CH2COOCH2CH3 - Ethyl butanoate (2): CH3CH2CH2COOCH2CH3
04

Perform the Claisen condensation

Now that we have identified the possible nucleophiles and electrophiles, we can perform the Claisen condensation reaction between them and find the four possible products: 1. Nucleophile (1) and electrophile (1) The product formed will be: CH3CH2C(O)CH2COOCH2CH3 2. Nucleophile (1) and electrophile (2) The product formed will be: CH3CH2C(O)CH2CH2COOCH2CH3 3. Nucleophile (2) and electrophile (1) The product formed will be: CH3CH2CH2C(O)CH2COOCH2CH3 4. Nucleophile (2) and electrophile (2) The product formed will be: CH3CH2CH2C(O)CH2CH2COOCH2CH3 These are the four possible Claisen condensation products when a 1:1 mixture of ethyl propanoate and ethyl butanoate is treated with sodium ethoxide.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Ethyl Propanoate
Ethyl propanoate is an ester that is used as a reactant in various chemical reactions, including the Claisen condensation mechanism. It has the chemical structure CH3CH2COOCH2CH3. In this structure, the ester functional group is represented by COO, which connects a propionic acid derivative to an ethyl group. During the Claisen condensation, ethyl propanoate can either donate its alkoxide group becoming a nucleophile, or it can accept the nucleophilic attack at the carbonyl carbon to become part of the new β-keto ester.

Esters like ethyl propanoate are known for their pleasant aromas and are often found in fragrances and flavorings. They also play a pivotal role in organic synthesis, acting as precursors to various compounds. In educational settings, understanding the properties and reactions of ethyl propanoate is essential for grasping concepts related to ester functionalities and their reactivity patterns.
Ethyl Butanoate
Ethyl butanoate, another ester, has the slightly longer chemical structure CH3CH2CH2COOCH2CH3. Similar to ethyl propanoate, this ester also features a COO group, but it is attached to a butyric acid derivative and an ethyl group. Ethyl butanoate is noted for having a fruity aroma and is commonly used in flavorings and perfumes. When employed in a Claisen condensation reaction, ethyl butanoate can behave as either a nucleophile or an electrophile.

By adjusting the length of the carbon chain in an ester, chemists can tweak its aroma and reactivity. Ethyl butanoate's slightly longer chain gives it distinct chemical properties compared to ethyl propanoate. These properties are vital for students to understand, as they help explain why different esters are preferred in various synthetic applications.
Sodium Ethoxide
Sodium ethoxide, with its formula NaOCH2CH3, serves as a potent base in the Claisen condensation mechanism. This inorganic compound is the sodium salt of ethanol and features an ethoxide ion (OCH2CH3) paired with a sodium cation (Na+). As a strong base, sodium ethoxide is crucial for deprotonating the ester, creating an enolate anion that can act as a nucleophile. This step is the starting point of the Claisen condensation, leading to the subsequent nucleophilic attack on another ester molecule.

The choice of base is critical in the reaction; sodium ethoxide is particularly suited for this role due to its ability to generate a good nucleophile without adding additional protons into the reaction mixture, which could quench the nucleophile or reverse the reaction. This concept is integral to organic synthesis and emphasizes the importance of base selection in driving the reaction towards the desired products.
β-Keto Ester Synthesis
The synthesis of β-keto esters is a fundamental transformation in organic chemistry. β-keto esters are characterized by having a ketone (carbonyl group) and an ester functional group on adjacent carbon atoms. The Claisen condensation is a classic method for synthesizing these compounds and involves the reaction of two ester molecules in the presence of a base, like sodium ethoxide, to form a new carbon-carbon bond. This process typically yields a β-keto ester, which exhibits increased reactivity due to the presence of both electron-withdrawing groups (the keto and ester functionalities) on the β-carbon.

The synthesis of β-keto esters has broad applications, including the preparation of more complex molecules and as intermediates in the synthesis of pharmaceuticals. For students, mastering the mechanism of β-keto ester synthesis via Claisen condensation allows the discovery of how intricate carbon frameworks can be constructed from simpler building blocks. This understanding paves the way for grasping more advanced topics in synthetic organic chemistry.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.

Sign-up for free