Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Draw stereorepresentations for all stereoisomers of this compound. Label those that are meso compounds and thooe that are pairs of enantiomers. CC1C(C(=O)O)CC(C(=O)O)C1(C)C

Short Answer

Expert verified
Answer: There are four possible stereoisomers for a compound with two chiral centers, and they can be organized into two pairs of enantiomers (non-superimposable mirror images). There are no meso compounds in this case, as none of the stereoisomers have an internal plane of symmetry.

Step by step solution

01

1. Identify the stereocenters

First, let's look at the structure of the given compound and identify the chiral centers. Chiral centers have four different groups attached to them. The given compound has two stereocenters (chiral centers).
02

2. Calculate the number of stereoisomers

Next, we will calculate the number of stereoisomers possible for the compound with two chiral centers. This can be calculated using the formula 2^n, where n is the number of chiral centers. In this case, it's 2^2 = 4.
03

3. Draw the stereorepresentations

Let's draw the four possible stereoisomers for the given compound: 1. Both chiral centers in R configuration 2. Both chiral centers in S configuration 3. One chiral center in R configuration and the other in S configuration 4. One chiral center in S configuration and the other in R configuration
04

4. Identify enantiomers and meso compounds

Now, we will compare each pair of stereoisomers (1 and 2, 3 and 4): 1. Stereocenters 1 and 2 - These two are non-superimposable mirror images of each other and therefore, they are enantiomers. 2. Stereocenters 3 and 4 - They are also non-superimposable mirror images of each other and form another pair of enantiomers. There are no meso compounds in this case as no stereoisomer found to have an internal plane of symmetry.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Stereochemistry
Stereochemistry is a subfield of chemistry that focuses on the spatial arrangement of atoms within molecules and how this arrangement affects the properties and reactions of those molecules. Imagine you're putting together a model; each piece must go in a specific place. Similarly, in stereochemistry, the layout of atoms can create different 'models' or isomers—molecules with the same molecular formula but with different structures.

Stereoisomers are unique categories of isomers that differ only in the three-dimensional orientations of their atoms in space. A famous analogy used to describe these spatial differences is that of your left and right hands—they are mirror images of each other but cannot be aligned perfectly when superimposed. This property is known as chirality, which is a central concept in stereochemistry and is critically important in fields like pharmaceuticals where the 3D structure of a compound can determine its therapeutic effect.
Chiral Centers
A chiral center, often referred to as a stereocenter, is a specific atom within a molecule that has four different groups attached to it. This uniqueness causes non-superimposable mirror images, or enantiomers, to exist.

Imagine standing in the middle of a room, with each hand touching something different—let's say a book, a cup, a ball, and a pen. If someone else stood in your place, they would need to have the exact items in their hands to be considered the same 'configuration'. If any item, say the cup, switched hands, this would create a different configuration. In chemistry, when a molecule has at least one chiral center, think of it like a junction where different paths (configurations) can be taken, leading to different three-dimensional structures for the molecule.
Meso Compounds
Meso compounds are a type of stereoisomer that, despite having multiple chiral centers, are achiral overall—meaning they do not exhibit optical activity. This occurs because meso compounds have an internal plane of symmetry that allows different parts of the molecule to cancel out each other's optical activity.

To better understand this, consider a paper cutout of a butterfly. If the butterfly is perfectly symmetrical and you fold it down the middle, both halves match exactly. A meso compound is like this butterfly; though it may appear to have chiral centers, the symmetry makes it possible to superimpose one half of the molecule onto the other, indicating that the molecule cannot have enantiomers. Meso compounds are quite interesting in stereochemistry because they contradict the expectation that a molecule with chiral centers must be chiral.
Enantiomers
Enantiomers are pairs of stereoisomers that are non-superimposable mirror images of each other, much like human hands. Enantiomers have identical physical properties in a non-chiral environment, such as melting point and boiling point. However, they rotate plane-polarized light in opposite directions—one clockwise and the other counterclockwise—a phenomenon known as optical activity.

It is important to visualize enantiomers as mirror images that cannot be aligned when superimposed. In the exercise provided, compounds with both chiral centers in R configuration and both in S configuration are enantiomers, as are the compounds with one center in R and the other in S. These pairs are chemically similar but can have dramatically different biological effects. The study of enantiomers is not just an academic exercise but a crucial aspect of drug design and synthesis in medicinal chemistry, where the 'right' or 'left' hand of a molecule can make a world of difference.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

If priority cannot be assigned on the basis of the atoms bonded directly to the chiral center [because of a tie (i.e., the same first atom on more than one substituent)], look at the next set of atoms and continte tuntil a priority can be assigned. Priority is assigned at the first point of difference. Following is a series of groups arranged in order of increasing priority. The atomic number of the atom on which the assignment of priority is based is shown above it.

To the following statements, answer true or false and explain your answer. (a) All chiral centers are also stereocenters. (b) All stereocenters are also chiral centers. (c) All chiral molecules are optically active when pure. (d) All mixtures of chiral molecules are optically active. (e) To be optically active, a molecule must have a chiral center. (f) To be meso, a molecule must have at least two chiral centers.

Think about the helical coil of a telephone cord or a spiral binding. Suppose that you view the spiral from one end and find that it is a left-handed twist. If you view the same spiral from the other end, is it a right-handed or left- handed twist?

Each atom bonded to the chiral center is assigned a priority. Priority is based on atomic number; the higher the atomic number, the higher the priority. Following are several substituents arranged in order of increasing priority. The atomic number of the atom determining priority is shown in parentheses.

If the optical rotation of a new compound is measured and found to have a specific rotation of \(+40\), how can you tell if the actual rotation is not really \(+40\) plus some multiple of \(+360\) ? In other words, how can you tell if the rotation is not actually a value such as \(+400\) or \(+760 ?\)

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.

Sign-up for free