Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Write structural formulas and line-angle formulas for the following alkanes and cycloalkanes. (a) \(2,2,4\)-Trimethylhexane (b) 2,2-Dimethylpropane (c) 3-Ethyl-2,4,5-trimethyloctane (d) 5 -Butyl-2,2-dimethylnonane (e) 4-(1-Methylethyl)octane (f) 3,3 -Dimethylpentane (g) trans-1,3-Dimethylcyclopentane (h) cis-1,2-Diethylcyclobutane

Short Answer

Expert verified
Question: Draw the structural and line-angle formulas for the given compounds: (a) 2,2,4-Trimethylhexane (b) 2,2-Dimethylpropane (c) 3-Ethyl-2,4,5-trimethyloctane (d) 5-Butyl-2,2-dimethylnonane (e) 4-(1-Methylethyl)octane (f) 3,3-Dimethylpentane (g) trans-1,3-Dimethylcyclopentane (h) cis-1,2-Diethylcyclobutane Answer: (a) ``` CH3 | CH3-CH2-CH-CH2-CH2-CH3 | CH3 ``` (b) ``` CH3-CH-CH3 | CH3 ``` (c) ``` CH3 | CH3-CH-CH2-CH-CH-CH2-CH2-CH2-CH3 | | | CH3 CH2-CH3 CH3 ``` (d) ``` CH3 CH3 CH3 | CH3-CH-CH2-CH-CH2-CH-CH2-CH2-CH2-CH3 | CH2-CH2-CH2-CH3 ``` (e) ``` CH3 CH3-CH CH3-CH2-CH-CH2-CH2-CH2-CH2-CH3 ``` (f) ``` CH3 | CH3-CH2-CH-CH2-CH3 | CH3 ``` (g) ``` CH3 | _____ / \ CH3-C---C-CH2 | / \___ ``` (h) ``` CH2-CH3 | ______ / | CH2-CH3 C---C | | \______/ ```

Step by step solution

01

(a) 2,2,4-Trimethylhexane

First, identify the main carbon chain, which is hexane, a linear chain of 6 carbon atoms. Add the methyl groups at positions 2, 2, and 4. The structural formula will look like this: ``` CH3-CH(CH3)-CH(CH3)-CH2-CH3 ``` Now convert it to a line-angle formula: ``` CH3 | CH3-CH2-CH-CH2-CH2-CH3 | CH3 ```
02

(b) 2,2-Dimethylpropane

The main carbon chain is propane (3 carbon atoms in a linear chain). Add the methyl groups at position 2. The structural formula will be: ``` CH3-CH(CH3)-CH3 ``` The line-angle formula is: ``` CH3-CH-CH3 | CH3 ```
03

(c) 3-Ethyl-2,4,5-trimethyloctane

The main carbon chain is octane, which has 8 carbon atoms. Add the ethyl group at position 3 and the methyl groups at positions 2, 4, and 5. The structural formula will be: ``` CH3-CH(CH3)-CH(CH2CH3)-CH(CH3)-CH(CH3)-CH2-CH2-CH3 ``` The line-angle formula is: ``` CH3 | CH3-CH-CH2-CH-CH-CH2-CH2-CH2-CH3 | | | CH3 CH2-CH3 CH3 ```
04

(d) 5-Butyl-2,2-dimethylnonane

The main carbon chain is nonane, which has 9 carbon atoms. Add the butyl group at position 5 and the methyl groups at position 2. The structural formula is: ``` CH3-CH(CH3)-CH(CH3)-CH2-CH(CH2CH2CH2CH3)-CH2-CH2-CH2-CH3 ``` The line-angle formula is: ``` CH3 CH3 CH3 | CH3-CH-CH2-CH-CH2-CH-CH2-CH2-CH2-CH3 | CH2-CH2-CH2-CH3 ```
05

(e) 4-(1-Methylethyl)octane

The main carbon chain is octane, which has 8 carbon atoms. Add the 1-methylethyl group at position 4. The structural formula is: ``` CH3-CH2-CH2-CH(CH(CH3)CH2)-CH2-CH2-CH2-CH3 ``` The line-angle formula is: ``` CH3 CH3-CH CH3-CH2-CH-CH2-CH2-CH2-CH2-CH3 ```
06

(f) 3,3-Dimethylpentane

The main carbon chain is pentane, which has 5 carbon atoms. Add the methyl groups at position 3. The structural formula is: ``` CH3-CH2-CH(CH3)-CH2-CH3 ``` The line-angle formula is: ``` CH3 | CH3-CH2-CH-CH2-CH3 | CH3 ```
07

(g) trans-1,3-Dimethylcyclopentane

The main carbon chain is cyclopentane, which is a ring of 5 carbon atoms. Add the methyl groups at positions 1 and 3. In the trans configuration, the two methyl groups are on opposite sides of the ring. The line-angle formula is: ``` CH3 | _____ / \ CH3-C---C-CH2 | / \___ ```
08

(h) cis-1,2-Diethylcyclobutane

The main carbon chain is cyclobutane, which is a ring of 4 carbon atoms. Add the ethyl groups at positions 1 and 2. In the cis configuration, the two ethyl groups are on the same side of the ring. The line-angle formula is: ``` CH2-CH3 | ______ / | CH2-CH3 C---C | | \______/ ```

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Line-Angle Formula Representation
The line-angle formula, also known as the skeletal formula, is a shorthand representation of a molecule in organic chemistry that simplifies the drawing of chemical structures. It is particularly useful for large and complex hydrocarbons like alkanes and cycloalkanes.

In this representation, carbon atoms are not shown explicitly but are assumed to be at the vertices of lines (bonds) or at the ends of lines where more than two lines meet. Hydrogen atoms bonded to carbon are also usually omitted if they fill the carbon's valence to four; those attached to anything other than carbon should be shown. Every line represents a covalent bond, and the ends of the lines or intersections represent carbon atoms.

For example, take the molecule of 2,2-dimethylpropane. The conventional structural formula can be cumbersome, depicting each carbon and hydrogen atom and their bonds; CH3-CH(CH3)-CH3. The line-angle formula simplifies this to a 'Y' shape, with the central carbon at the intersection and the methyl groups radiating outwards. The assumption of the line-angle formula is that if you see a line end or intersection, you can infer the presence of a carbon atom with the appropriate number of hydrogen atoms to reach four bonds.

Using line-angle formulas makes it vastly easier for students to visualize the 3D structure of molecules and is a convenient way to express the structure of large organic molecules without cluttering the drawing with numerous carbon and hydrogen atoms.
Chemical Nomenclature of Organic Compounds
Understanding the chemical nomenclature of organic compounds is essential for students as it allows precise communication about molecular structures. Chemical nomenclature follows specific rules standardized by IUPAC (International Union of Pure and Applied Chemistry) to systematically name a chemical compound based on its structure.

Alkanes, for instance, have a suffix '-ane' and begin with a prefix indicating the number of carbon atoms present in the longest continuous chain (e.g., 'meth-' for one carbon, 'eth-' for two carbons). When naming branched alkanes, one first identifies the longest carbon chain in the molecule as the main chain, with all other groups attached to this chain referred to as substituents. The substituents are named with a prefix such as 'methyl-' for a single carbon branch and 'ethyl-' for a two-carbon branch, followed by a number indicating their position on the main chain.

For example, '3-Ethyl-2,4,5-trimethyloctane' indicates an eight-carbon alkane with an ethyl group on the third carbon and three methyl groups on the second, fourth, and fifth carbons. Proper nomenclature not only includes the type and number of branches but also their position, which is critical for identifying the correct molecule out of potentially many structural isomers.
Isomerism in Organic Chemistry
Isomerism is a fundamental concept in organic chemistry that highlights the importance of molecular structure. Isomers are molecules with the same molecular formula but different structural arrangements. Understanding isomerism is crucial for students because it affects the physical and chemical properties of a compound.

There are several types of isomerism, but in the context of alkanes and cycloalkanes, two primary types include constitutional isomers and stereoisomers. Constitutional isomers (also known as structural isomers) have the same molecular formula but differ in the connectivity of atoms. For example, butane and isobutane are constitutional isomers—they both have a formula of C4H10, but butane has a straight chain, whereas isobutane has a branched chain.

Stereoisomers have the same molecular formula and sequence of bonded atoms (constitution), but differ in the three-dimensional orientations of their atoms in space. A common type of stereoisomerism in cycloalkanes is cis-trans isomerism, which hinges on the relative orientation of substituent groups around a ring. In 'cis' isomers, similar groups are on the same side of a ring or double bond, while in 'trans' isomers, they are on opposite sides. The 'trans-1,3-Dimethylcyclopentane' mentioned in the exercise has the two methyl groups on opposite sides of the cyclopentane ring, and this has distinct chemical properties from its 'cis' counterpart.

Grasping the diverse forms of isomerism is key to predicting the behavior of organic molecules, and it fundamentally challenges students to appreciate how a simple change in structure can lead to entirely different compounds.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.

Sign-up for free