Question

Draw a structural formula for each compound. (a) \(N\)-Cyclohexylacetamide (b) 1-Methylpropyl methanoate (c) Cyclobutyl butanoate (d) \(N\)-(1-Methylheptyl) succinimide (e) Diethyl adipate (f) 2-Aminopropanamide

Short answer

Question: Draw structural formulas for the following compounds: a) N-Cyclohexylacetamide b) 1-Methylpropyl methanoate c) Cyclobutyl butanoate d) N-(1-Methylheptyl) succinimide e) Diethyl adipate f) 2-Aminopropanamide Answer: a) CH3CONHC6H11 b) CH3C(CH3)CH2O2CCH3 c) C4H7O2CC4H8 d) CH2CH(CONHC(CH3)(CH2)6CH3) CO e) O2C(CH2)4C(OCH2CH3)2, or HO2C(CH2)4CO2Et2 f) CH3CH(NH2)CONH2

Step-by-step solution

(a) N-Cyclohexylacetamide

First, identify the functional groups and structures in the name. This molecule contains an acetamide functional group and a cyclohexyl substituent. Start by drawing an acetamide group, which consists of a carbonyl group (C=O) bonded to an amine group (NH2). Now replace one hydrogen atom of the amine group with a cyclohexyl group, which consists of a six-membered carbon ring. The cyclohexyl group should be connected to the nitrogen atom of the amine group. The final structure is: \(CH_3CONHC_6H_{11}\)

(b) 1-Methylpropyl methanoate

Identify the functional groups and structures in the name. This molecule contains a methanoate functional group and a 1-methylpropyl substituent. Start by drawing a methanoate group, which consists of a carbonyl group (C=O) bonded to an alkoxy group (OMe). Now, draw a 1-methylpropyl group, which is a three carbon chain with a methyl group attached to the terminal carbon. Finally, connect the oxygen atom of the alkoxy group of the methanoate to the first carbon atom of the 1-methylpropyl group. The final structure is: \(CH_3C(CH_3)CH_2O_2CCH_3\)

(c) Cyclobutyl butanoate

Identify the functional groups and structures in the name. This molecule contains a butanoate functional group and a cyclobutyl substituent. Start by drawing a butanoate group, which consists of a carbonyl group (C=O) bonded to an alkoxy group (OC\(_4\)H\(_9\)). Now, draw a cyclobutyl group, which is a four-membered carbon ring. Finally, connect the oxygen atom of the alkoxy group of the butanoate to one of the carbon atoms of the cyclobutyl group. The final structure is: \(C_4H_7O_2CC_4H_8\)

(d) N-(1-Methylheptyl) succinimide

Identify the functional groups and structures in the name. This molecule contains a succinimide functional group and a 1-methylheptyl substituent. Start by drawing a succinimide group, which consists of a cyclic imide, containing two carbonyl (C=O) groups and one nitrogen (N) atom in a five-membered ring. Next, draw a 1-methylheptyl group, which is a seven carbon chain with a methyl group attached to the terminal carbon. Finally, connect the nitrogen atom of the succinimide to the first carbon atom of the 1-methylheptyl group. The final structure is: \(CH_2CH(CONHC(CH_3)(CH_2)_6CH_3) CO\)

(e) Diethyl adipate

Identify the functional groups and structures in the name. This molecule contains an adipate functional group and two ethyl groups. Start by drawing an adipate group, which consists of a six-carbon chain with carbonyl (C=O) groups at both ends of the chain. Now, draw two ethyl groups (CH\(_3\)CH\(_2\)) and connect each one to the oxygen atom of the carbonyl group at both ends of the adipate. The final structure is: \(O_2C(CH_2)_4C(OCH_2CH_3)_2\), or \(HO_2C(CH_2)_4CO_2Et_2\)

(f) 2-Aminopropanamide

Identify the functional groups and structures in the name. This molecule contains an amine group at the 2 position and an amide functional group. Start by drawing a three-carbon chain (propane); then replace the second carbon's hydrogen atoms with an amine group (NH\(_2\)) and the third carbon's hydrogen atom with an amide functional group (CONH\(_2\)). The final structure is: \(CH_3CH(NH_2)CONH_2\)