Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Problem 17

Given here are \({ }^{1} \mathrm{H}\)-NMR and \({ }^{13} \mathrm{C}-\mathrm{NMR}\) spectral data for nine compounds. Each compound shows strong absorption between 1720 and \(1700 \mathrm{~cm}^{-1}\) and strong, broad absorption over the region \(2500-3300 \mathrm{~cm}^{-1}\). Propose a structural formula for each compound. Refer to Appendices 4,5 , and 6 for spectral correlation tables. $$ \begin{aligned} &\text { (a) } \mathrm{C}_{5} \mathrm{H}_{10} \mathrm{O}_{2}\\\ &\begin{array}{|cc|} \hline{ }^{1} H-N M R & { }^{13} \text { C-NMR } \\ \hline 0.94(\mathrm{t}, 3 \mathrm{H}) & 180.71 \\ 1.39(\mathrm{~m}, 2 \mathrm{H}) & 33.89 \\ 1.62(\mathrm{~m}, 2 \mathrm{H}) & 26.76 \\ 2.35(\mathrm{t}, 2 \mathrm{H}) & 22.21 \\ 12.0(\mathrm{~s}, 1 \mathrm{H}) & 13.69 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (b) } \mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O}_{2}\\\ &\begin{array}{|cc|} \hline{ }^{1} \mathrm{H}-\mathrm{NMR} & { }^{13} \mathrm{C}-\mathrm{NMR} \\ \hline 1.08(\mathrm{~s}, 9 \mathrm{H}) & 179.29 \\ 2.23(\mathrm{~s}, 2 \mathrm{H}) & 47.82 \\ 12.1(\mathrm{~s}, 1 \mathrm{H}) & 30.62 \\ & 29.57 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (c) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{O}_{4}\\\ &\begin{array}{|cc|} \hline{ }^{1} H-N M R & { }^{13} \text { C-NMR } \\ \hline 0.93(\mathrm{t}, 3 \mathrm{H}) & 170.94 \\ 1.80(\mathrm{~m}, 2 \mathrm{H}) & 53.28 \\ 3.10(\mathrm{t}, 1 \mathrm{H}) & 21.90 \\ 12.7(\mathrm{~s}, 2 \mathrm{H}) & 11.81 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (d) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{O}_{4}\\\ &\begin{array}{|cc|} \hline{ }^{1} \text { H-NMR } & { }^{13} \mathrm{C}-\mathrm{NMR} \\ \hline 1.29(\mathrm{~s}, 6 \mathrm{H}) & 174.01 \\ 12.8(\mathrm{~s}, 2 \mathrm{H}) & 48.77 \\ & 22.56 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (e) } \mathrm{C}_{4} \mathrm{H}_{6} \mathrm{O}_{2}\\\ &\begin{array}{|cc|} \hline{ }^{1} H-N M R & { }^{13} \text { C-NMR } \\ \hline 1.91(\mathrm{~d}, 3 \mathrm{H}) & 172.26 \\ 5.86(\mathrm{~d}, 1 \mathrm{H}) & 147.53 \\ 7.10(\mathrm{~m}, 1 \mathrm{H}) & 122.24 \\ 12.4(\mathrm{~s}, 1 \mathrm{H}) & 18.11 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (f) } \mathrm{C}_{3} \mathrm{H}_{4} \mathrm{Cl}_{2} \mathrm{O}_{2}\\\ &\begin{array}{|cc|} \hline{ }^{1} \mathrm{H}-\mathrm{NMR} & { }^{13} \mathrm{C}-\mathrm{NMR} \\ \hline 2.34(\mathrm{~s}, 3 \mathrm{H}) & 171.82 \\ 11.3(\mathrm{~s}, 1 \mathrm{H}) & 79.36 \\ & 34.02 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (g) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{Cl}_{2} \mathrm{O}_{2}\\\ &\begin{array}{|cr|} \hline{ }^{1} \mathrm{H}-\mathrm{NMR} & { }^{13} \mathrm{C}-\mathrm{NMR} \\ \hline 1.42(\mathrm{~s}, 6 \mathrm{H}) & 180.15 \\ 6.10(\mathrm{~s}, 1 \mathrm{H}) & 77.78 \\ 12.4(\mathrm{~s}, 1 \mathrm{H}) & 51.88 \\ & 20.71 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (h) } \mathrm{C}_{5} \mathrm{H}_{9} \mathrm{BrO}_{2}\\\ &\begin{array}{|cr|} \hline \text { 1H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.97(\mathrm{t}, 3 \mathrm{H}) & 176.36 \\ 1.50(\mathrm{~m}, 2 \mathrm{H}) & 45.08 \\ 2.05(\mathrm{~m}, 2 \mathrm{H}) & 36.49 \\ 4.25(\mathrm{t}, 1 \mathrm{H}) & 20.48 \\ 12.1(\mathrm{~s}, 1 \mathrm{H}) & 13.24 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (i) } \mathrm{C}_{4} \mathrm{H}_{8} \mathrm{O}_{3}\\\ &\begin{array}{|cc|} \hline{ }^{1} H-N M R & { }^{13} \text { C-NMR } \\ \hline 2.62(\mathrm{t}, 2 \mathrm{H}) & 177.33 \\ 3.38(\mathrm{~s}, 3 \mathrm{H}) & 67.55 \\ 3.68(\mathrm{~s}, 2 \mathrm{H}) & 58.72 \\ 11.5(\mathrm{~s}, 1 \mathrm{H}) & 34.75 \\ \hline \end{array} \end{aligned} $$

Problem 20

Show how to prepare pentanoic acid from each compound. (a) 1-Pentanol (b) Pentanal (c) 1-Pentene (d) 1-Butanol (e) 1-Bromopropane (f) 1-Hexene

Problem 21

Draw the structural formula of a compound with the given molecular formula that, upon oxidation by potassium dichromate in aqueous sulfuric acid, gives the carboxylic acid or dicarboxylic acid shown. (a) \(\mathrm{C}_{6} \mathrm{H}_{14} \mathrm{O} \stackrel{\text { oxidation }}{\longrightarrow}\) CCCCCC(=O)O (b) \(\mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O} \stackrel{\text { oxidation }}{\longrightarrow}\) CCCCCC(=O)O (c) \(\mathrm{C}_{6} \mathrm{H}_{14} \mathrm{O}_{2}\) O=C(O)CCCCC(=O)O

Problem 23

Succinic acid can be synthesized by the following series of reactions from acetylene. Show the reagents and experiential conditions necessary to carry out this synthesis.

Problem 24

The reaction of an \(\alpha\)-diketone with concentrated sodium or potassium hydroxide to give the salt of an \(\alpha\)-hydroxyacid is given the general name benzil-benzilic acid rearrangement. It is illustrated by the conversion of benzil to sodium benzilate and then to benzilic acid. Propose a mechanism for this rearrangement. O=C(C(=O)c1ccccc1)c1ccccc1 O=C(O)C(O)(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 Benzil Sodium benzilate Benzilic acid

Problem 25

Select the stronger acid in each set. (a) Phenol \(\left(\mathrm{p} K_{\mathrm{a}} 9.95\right)\) and benzoic acid \(\left(\mathrm{p} K_{\mathrm{a}} 4.19\right)\) (b) Lactic acid \(\left(K_{\mathrm{a}} 8.4 \times 10^{-4}\right)\) and ascorbic acid \(\left(K_{\mathrm{a}} 7.9 \times 10^{-5}\right)\)

Problem 27

Low-molecular-weight dicarboxylic acids normally exhibit two different \(\mathrm{p} K_{\mathrm{a}}\) values. Ionization of the first carboxyl group is easier than the second. This effect diminishes with molecular size, and for adipic acid and longer chain dicarboxylic acids, the two acid ionization constants differ by about one \(\mathrm{p} K\) unit. $$ \begin{array}{|llll|} \hline \text { Dicarboxylic Acid } & \text { Structural Formula } & \mathrm{p} \kappa_{\mathrm{a} 1} & \mathrm{p} K_{\mathrm{a} 2} \\ \hline \text { Oxalic } & \mathrm{HOOCCOOH} & 1.23 & 4.19 \\ \text { Malonic } & \mathrm{HOOCCH}{ }_{2} \mathrm{COOH} & 2.83 & 5.69 \\ \text { Succinic } & \mathrm{HOOC}\left(\mathrm{CH}_{2}\right)_{2} \mathrm{COOH} & 4.16 & 5.61 \\ \text { Glutaric } & \mathrm{HOOC}\left(\mathrm{CH}_{2}\right)_{3} \mathrm{COOH} & 4.31 & 5.41 \\ \text { Adipic } & \mathrm{HOOC}\left(\mathrm{CH}_{2}\right)_{4} \mathrm{COOH} & 4.43 & 5.41 \\ \hline \end{array} $$ Why do the two \(\mathrm{p} K_{\mathrm{a}}\) values differ more for the shorter chain dicarboxylic acids than for the longer chain dicarboxylic acids?

Problem 29

The normal pH range for blood plasma is 7.35-7.45. Under these conditions, would you expect the carboxyl group of lactic acid \(\left(\mathrm{p} K_{\mathrm{a}} 3.08\right)\) to exist primarily as a carboxyl group or as a carboxylic anion? Explain.

Problem 30

The \(K_{\mathrm{a} 1}\) of ascorbic acid is \(7.94 \times 10^{-5}\). Would you expect ascorbic acid dissolved in blood plasma ( \(\mathrm{pH} 7.35-7.45\) ) to exist primarily as ascorbic acid or as ascorbate anion? Explain.

Problem 31

Excess ascorbic acid is excreted in the urine, the \(\mathrm{pH}\) of which is normally in the range 4.8-8.4. What form of ascorbic acid would you expect to be present in urine of \(\mathrm{pH} 8.4\) free ascorbic acid or ascorbate anion? Explain.

Access millions of textbook solutions in one place

  • Access over 3 million high quality textbook solutions
  • Access our popular flashcard, quiz, mock-exam and notes features
  • Access our smart AI features to upgrade your learning
Get Vaia Premium now
Access millions of textbook solutions in one place

Recommended explanations on Chemistry Textbooks