Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Draw structural formulas for (a) The eight alcohols with the molecular formula \(\mathrm{C}_{5} \mathrm{H}_{12} \mathrm{O}\). (b) The eight aldehydes with the molecular formula \(\mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O}\). (c) The six ketones with the molecular formula \(\mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O}\). (d) The eight carboxylic acids with the molecular formula \(\mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O}_{2}\). (e) The nine carboxylic esters with the molecular formula \(\mathrm{C}_{5} \mathrm{H}_{10} \mathrm{O}_{2}\). \(\mathbf{1 . 4 8}\) Identify the functional groups in each compound.

Short Answer

Expert verified
Question: List the structural formulas and functional groups for each type of the organic compounds with the given molecular formula. a) Alcohols with molecular formula C5H12O b) Aldehydes with molecular formula C6H12O c) Ketones with molecular formula C6H12O d) Carboxylic acids with molecular formula C6H12O2 e) Carboxylic esters with molecular formula C5H10O2 Answer: a) Alcohols: 1. 1-pentanol: CH3-CH2-CH2-CH2-CH2OH (OH group) 2. 2-pentanol: CH3-CH2-CH(OH)-CH2-CH3 (OH group) 3. 3-pentanol: CH3-CH2-CH2(OH)-CH2-CH3 (OH group) 4. 2-methyl-1-butanol: CH3-CH2-CH(CH3)-CH2OH (OH group) 5. 3-methyl-1-butanol: CH3-CH(CH3)-CH2-CH2OH (OH group) 6. 2-methyl-2-butanol: CH3-CH(OH)-CH(CH3)-CH3 (OH group) 7. 3-methyl-2-butanol: CH3-CH2-CH(OH)-CH(CH3)-CH3 (OH group) 8. 2,2-dimethyl-1-propanol: CH3-C(OH)(CH3)-CH2-CH3 (OH group) b) Aldehydes: 1. Hexanal: CH3-CH2-CH2-CH2-CH2-CHO (CHO group) 2. 2-methylpentanal: CH3-CH2-CH(CH3)-CH2-CHO (CHO group) 3. 3-methylpentanal: CH3-CH(CH3)-CH2-CH2-CHO (CHO group) 4. 4-methylpentanal: CH3-CH2-CH2-CH(CH3)-CHO (CHO group) 5. 2-ethylbutanal: CH3-CH(CH2-CH3)-CH2-CHO (CHO group) 6. 2,3-dimethylbutanal: CH3-C(CH3)-CH(CH3)-CHO (CHO group) 7. 3,3-dimethylbutanal: CH3-CH(C(CH3)2)-CHO (CHO group) 8. 2,2-dimethylpentanal: CH3-C(CH3)-CH2-CH2-CHO (CHO group) c) Ketones: 1. 2-hexanone: CH3-CH2-CH2-CH2-CO-CH3 (C=O group) 2. 3-hexanone: CH3-CH2-CH2-CO-CH2-CH3 (C=O group) 3. 3-methyl-2-pentanone: CH3-CH2-C(CH3)CO-CH2-CH3 (C=O group) 4. 2-methyl-3-pentanone: CH3-CH2-CH(C(CH3)2)CO-CH3 (C=O group) 5. 4-methyl-3-pentanone: CH3-CH2-CH(CO)CH(CH3)-CH3 (C=O group) 6. 3,3-dimethyl-2-butanone: CH3-C(CH3)-CO-CH(CH3)2 (C=O group) d) Carboxylic acids: 1. Hexanoic acid: CH3-CH2-CH2-CH2-CH2-COOH (COOH group) 2. 2-methylpentanoic acid: CH3-CH2-CH(CH3)-CH2-COOH (COOH group) 3. 3-methylpentanoic acid: CH3-CH(CH3)-CH2-CH2-COOH (COOH group) 4. 4-methylpentanoic acid: CH3-CH2-CH2-CH(CH3)-COOH (COOH group) 5. 2-ethylbutanoic acid: CH3-CH(CH2-CH3)-CH2-COOH (COOH group) 6. 2,3-dimethylbutanoic acid: CH3-C(CH3)-CH(CH3-COOH (COOH group) 7. 3,3-dimethylbutanoic acid: CH3-CH(C(CH3)2)-COOH (COOH group) 8. 2,2-dimethylpentanoic acid: CH3-C(CH3)-CH2-CH2-COOH (COOH group) e) Carboxylic esters: 1. Ethyl propanoate: CH3-CH2-COO-CH2-CH3 (COO group) 2. Methyl butanoate: CH3-COO-CH2-CH2-CH3 (COO group) 3. Methyl 2-methylpropanoate: CH3-C(CH3)-COO-CH3 (COO group) 4. Isopropyl acetate: CH3-COO-CH(CH3)2 (COO group) 5. Ethyl 2-methylpropanoate: CH3-CH2-C(CH3)-COO-CH3 (COO group) 6. Propyl acetate: CH3-COO-CH2-CH2-CH3 (COO group) 7. Butyl acetate: CH3COO-(CH2)3-CH3 (COO group) 8. Ethyl 2,2-dimethylpropanoate: CH3-CH2-C(CH3)2-COO-CH3 (COO group) 9. 3-Methylbutyl acetate: CH3-COO-CH(CH3)-CH2-CH3 (COO group)

Step by step solution

01

(Part a: Alcohols with molecular formula C5H12O)

To draw the alcohols with the given molecular formula, we need to find all the possible structural isomers containing an OH group as the alcohol functional group. Let's list them one by one: 1. 1-pentanol: CH3-CH2-CH2-CH2-CH2OH 2. 2-pentanol: CH3-CH2-CH(OH)-CH2-CH3 3. 3-pentanol: CH3-CH2-CH2(OH)-CH2-CH3 4. 2-methyl-1-butanol: CH3-CH2-CH(CH3)-CH2OH 5. 3-methyl-1-butanol: CH3-CH(CH3)-CH2-CH2OH 6. 2-methyl-2-butanol: CH3-CH(OH)-CH(CH3)-CH3 7. 3-methyl-2-butanol: CH3-CH2-CH(OH)-CH(CH3)-CH3 8. 2,2-dimethyl-1-propanol: CH3-C(OH)(CH3)-CH2-CH3 These are the eight possible alcohols with the molecular formula C5H12O.
02

(Part b: Aldehydes with molecular formula C6H12O)

To draw the aldehydes, we need to find all the possible structural isomers having the molecular formula C6H12O and containing a CHO group as their functional group. Let's list them as follows: 1. Hexanal: CH3-CH2-CH2-CH2-CH2-CHO 2. 2-methylpentanal: CH3-CH2-CH(CH3)-CH2-CHO 3. 3-methylpentanal: CH3-CH(CH3)-CH2-CH2-CHO 4. 4-methylpentanal: CH3-CH2-CH2-CH(CH3)-CHO 5. 2-ethylbutanal: CH3-CH(CH2-CH3)-CH2-CHO 6. 2,3-dimethylbutanal: CH3-C(CH3)-CH(CH3)-CHO 7. 3,3-dimethylbutanal: CH3-CH(C(CH3)2)-CHO 8. 2,2-dimethylpentanal: CH3-C(CH3)-CH2-CH2-CHO These are the eight possible aldehydes with the molecular formula C6H12O.
03

(Part c: Ketones with molecular formula C6H12O)

To draw the ketones with the given molecular formula, we need to find all the possible structural isomers containing a C=O group as the carbonyl functional group and not at the end of the carbon chain. Let's list them as follows: 1. 2-hexanone: CH3-CH2-CH2-CH2-CO-CH3 2. 3-hexanone: CH3-CH2-CH2-CO-CH2-CH3 3. 3-methyl-2-pentanone: CH3-CH2-C(CH3)CO-CH2-CH3 4. 2-methyl-3-pentanone: CH3-CH2-CH(C(CH3)2)CO-CH3 5. 4-methyl-3-pentanone: CH3-CH2-CH(CO)CH(CH3)-CH3 6. 3,3-dimethyl-2-butanone: CH3-C(CH3)-CO-CH(CH3)2 These are the six possible ketones with the molecular formula C6H12O.
04

(Part d: Carboxylic acids with molecular formula C6H12O2)

To draw the carboxylic acids with the given molecular formula, we need to find all the possible structural isomers containing a COOH group. Let's list the unique carboxylic acids: 1. Hexanoic acid: CH3-CH2-CH2-CH2-CH2-COOH 2. 2-methylpentanoic acid: CH3-CH2-CH(CH3)-CH2-COOH 3. 3-methylpentanoic acid: CH3-CH(CH3)-CH2-CH2-COOH 4. 4-methylpentanoic acid: CH3-CH2-CH2-CH(CH3)-COOH 5. 2-ethylbutanoic acid: CH3-CH(CH2-CH3)-CH2-COOH 6. 2,3-dimethylbutanoic acid: CH3-C(CH3)-CH(CH3-COOH 7. 3,3-dimethylbutanoic acid: CH3-CH(C(CH3)2)-COOH 8. 2,2-dimethylpentanoic acid: CH3-C(CH3)-CH2-CH2-COOH These are the eight possible carboxylic acids with the molecular formula C6H12O2.
05

(Part e: Carboxylic esters with molecular formula C5H10O2)

To draw the carboxylic esters with the given molecular formula, we need to find all possible structural isomers containing a COO group. Let's list the unique carboxylic esters: 1. Ethyl propanoate: CH3-CH2-COO-CH2-CH3 2. Methyl butanoate: CH3-COO-CH2-CH2-CH3 3. Methyl 2-methylpropanoate: CH3-C(CH3)-COO-CH3 4. Isopropyl acetate: CH3-COO-CH(CH3)2 5. Ethyl 2-methylpropanoate: CH3-CH2-C(CH3)-COO-CH3 6. Propyl acetate: CH3-COO-CH2-CH2-CH3 7. Butyl acetate: CH3COO-(CH2)3-CH3 8. Ethyl 2,2-dimethylpropanoate: CH3-CH2-C(CH3)2-COO-CH3 9. 3-Methylbutyl acetate: CH3-COO-CH(CH3)-CH2-CH3 These are the nine possible carboxylic esters with the molecular formula C5H10O2.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Understanding Alcohols Molecular Formula
Alcohols are organic compounds characterized by the presence of one or more hydroxyl (-OH) groups attached to a carbon atom. Their general molecular formula is CnH2n+2O for an alcohol with a single hydroxyl group. In the exercise, the task was to find all alcohols with the molecular formula C5H12O. These alcohols have a carbon backbone of five carbon atoms and a single hydroxyl group.

When striving for clarity, it's important to note that alcohols can vary in structure by shifting the position of the hydroxyl group and by branching of the carbon chain. The exercise provided a primer on how to draw these structural isomers, each with unique properties due to their different structures.
Aldehydes Molecular Formula Demystified
Aldehydes are another class of organic compounds, which have a carbonyl group (C=O) bonded to a hydrogen atom and at the end of a carbon chain. The carbonyl group defines the molecule as an aldehyde. Their molecular formula typically takes the form of CnH2nO. In the specific case of C6H12O, the aldehydes contain a six-carbon chain backbone.

By placing the aldehyde group (CHO) at the end of various carbon chain structures, during the exercise, students learn to create distinct structural isomers. The exercise shows the need for attention to both the carbon chain's structure and the placement of the aldehyde group.
Ketones Molecular Formula Explained
Ketones are identified by their characteristic carbonyl group (C=O) positioned within the carbon skeleton; notably, it is not at the end like in aldehydes. The general formula for ketones akin to aldehydes is CnH2nO. When drawing the six ketones with the molecular formula C6H12O, as in the exercise, students visualize different ways of incorporating the carbonyl group into the carbon framework without placing it at the terminal position.

It's invaluable for students to realize how the positioning of the carbonyl group influences the naming and properties of ketones. This exercise clearly demonstrates the need for understanding organic chemistry nomenclature.
Carboxylic Acids Molecular Formula Insights
Carboxylic acids are equipped with a carboxyl group (-COOH), easily identifiable as the defining feature. Their general molecular formula is CnH2n+1COOH. The task to draw carboxylic acids with the molecular formula C6H12O2 challenges students to arrange six carbon atoms and the carboxyl group into various structures.

The solution lists distinct isomers, highlighting how the nature of the carbon chain (straight or branched) and the position of the carboxyl group affect the acid's chemical behavior. This illustrates how structural differences impact a molecule's properties and emphasizes the importance of detailed structural visualization.
Decoding Carboxylic Esters Molecular Formula
Carboxylic esters are organic compounds formed by the reaction of a carboxylic acid and an alcohol, characterized by the ester functional group (-COO-). With the molecular formula C5H10O2, carboxylic esters present a wide range of structural possibilities, as shown in the exercise where students need to draw nine unique structural isomers.

Each ester's structure, as presented in the step-by-step solution, varies by the alcohol and acid part contributing to the ester group. This task reinforces the concept that the molecular arrangement deeply influences an ester's chemical identity and behavior.
Organic Chemistry Nomenclature Made Simple
Organic chemistry nomenclature can seem daunting, yet it's crucial for clearly communicating the structures of molecules. It follows systematic rules that allow chemists to derive the name of a compound from its structure and vice versa. Among the key lessons from the exercise is the importance of locating functional groups, identifying the longest carbon chain, and recognizing substituent groups to determine the proper names for various isomers.

Guided by the International Union of Pure and Applied Chemistry (IUPAC) rules, the exercise urges students to appreciate the logic behind naming complex molecules by starting with simpler ones, incrementally compounding their understanding with practice.
Identifying Functional Groups
Functional groups are specific groups of atoms within molecules that dictate how those molecules will react. They are the reactive parts of molecules and are largely responsible for the properties of organic compounds. The exercise includes identifying different functional groups like hydroxyl, carbonyl, carboxyl, and ester groups across various molecular structures.

Understanding how to spot these groups helps students to categorize compounds and anticipate their physical and chemical properties. As illustrated in the step-by-step solutions, each type of compound (alcohols, aldehydes, ketones, carboxylic acids, and esters) bears a unique functional group that defines its class.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.

Sign-up for free