Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Work out reasonable mechanisms for the reactions of phosphorus pentachloride and sulfur tetrafluoride with carbonyl groups. A reasonable first step with phosphorus pentachloride is dissociation into PCl4 and ClΘ.

Short Answer

Expert verified
The reaction mechanism for phosphorus pentachloride (PCl5) with carbonyl groups involves three steps: 1. Dissociation of PCl5 into PCl4+ and Cl-. 2. Nucleophilic attack of carbonyl oxygen on PCl4+, displacement of Cl- ion. 3. Reformation of PCl5 and formation of a chlorinated carbonyl compound. The reaction mechanism for sulfur tetrafluoride (SF4) with carbonyl groups involves two steps: 1. Nucleophilic attack of carbonyl oxygen on SF4. 2. Fluoride ion transfer from sulfur to carbonyl carbon, forming a fluorinated carbonyl compound and releasing SF3.

Step by step solution

01

Dissociation of Phosphorus Pentachloride

As given in the problem, the first step for the reaction of phosphorus pentachloride with carbonyl group is the dissociation of PCl5 into PCl4+ and Cl-. PCl5PCl4++Cl
02

Nucleophilic attack of carbonyl oxygen on PCl4+

The nucleophilic oxygen of the carbonyl group attacks the electrophilic phosphorus center in PCl4+, forming a new bond between the oxygen and phosphorus atoms. O=CR+PCl4+OPCl4OP(Cl)3+Cl
03

Reformation of phosphorus pentachloride

After the displacement of one Cl- ion from OP(Cl)3, the Cl- ion that was initially dissociated from PCl5 in step 1 can now reattach to OP(Cl)3 forming phosphorus pentachloride (PCl5) and a chlorinated carbonyl compound. OP(Cl)3+ClO=C(R)Cl+PCl5 The mechanism for the reaction of phosphorus pentachloride with the carbonyl group has the following three steps: 1. Dissociation of PCl5. 2. Nucleophilic attack of carbonyl oxygen on PCl4+ and displacement of Cl-. 3. Reformation of phosphorus pentachloride and formation of a chlorinated carbonyl compound. Now let's investigate the mechanism of the sulfur tetrafluoride reaction with carbonyl groups.
04

Nucleophilic attack of carbonyl oxygen on SF4

In the reaction of sulfur tetrafluoride with carbonyl groups, the nucleophilic oxygen of the carbonyl group attacks the electrophilic sulfur center in SF4, forming a new bond between the oxygen and sulfur atoms. O=CR+SF4OSF4
05

Fluoride ion transfers from sulfur to carbonyl carbon

After the formation of the new bond, the fluoride ion transfers from the sulfur to carbon, releasing a molecule of SF3 and forming a fluorinated carbonyl compound. OSF4OC(R)F+SF3 The mechanism for the reaction of sulfur tetrafluoride with the carbonyl group has the following two steps: 1. Nucleophilic attack of carbonyl oxygen on SF4. 2. Fluoride ion transfers from sulfur to carbonyl carbon, forming a fluorinated carbonyl compound, and releasing SF3. In summary, we have elucidated the reasonable mechanisms for the reactions of phosphorus pentachloride and sulfur tetrafluoride with carbonyl groups to form chlorinated and fluorinated carbonyl compounds, respectively.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Nucleophilic Attack
In organic chemistry, a nucleophilic attack is a fundamental concept where an electron-rich species, the nucleophile, targets an electron-deficient center, called the electrophile.
One of the most common scenarios is in carbonyl group reactions. Here, the oxygen of the carbonyl group acts as the nucleophile due to its lone pairs of electrons. It attacks an electron-poor region, such as a positively charged phosphorus in PCl4+.
- *Key Features of Nucleophilic Attack:* - The nucleophile must have a lone pair of electrons or be negatively charged. - The electrophile generally exhibits a positive charge or a partial positive charge.
Understanding nucleophilic attack is crucial in predicting the behavior of molecules during chemical transformations. In our example involving phosphorus pentachloride, the nucleophilic oxygen initiates the reaction mechanism. This ensures the formation of a bond that is central to the continued transformation in the reaction pathway.
Carbonyl Group Chemistry
The chemistry involving carbonyl groups (C=O) is pivotal in many organic reactions due to its polar nature.
The carbonyl carbon, being electrophilic due to the electronegative oxygen, becomes susceptible to nucleophilic attacks.
- *Significance of Carbonyl Group:* - It is both a site for nucleophilic attack and is influential in directing pathways in reactions. - Plays a central role in reactions such as oxidation, reduction, and condensation.
In the mechanisms with phosphorus pentachloride, the carbonyl group chemistry allows the nucleophilic oxygen to react with the phosphorus center, leading to key transitions.
This not only forms new bonds but also rearranges existing ones, demonstrating the versatile behavior of carbonyl compounds in complex reactions.
Chlorination and Fluorination Mechanisms
Chlorination and fluorination involve the addition of chlorine or fluorine atoms to organic molecules, often altering their reactivity and properties.
In our exercises, these processes interact significantly with carbonyl groups.
- *Chlorination:* - With phosphorus pentachloride, chlorination occurs as the chlorine atom from Cl attaches to the carbonyl carbon, forming a chlorinated compound. - This step often renders the compound more reactive or modifies its physical properties.
- *Fluorination From Sulfur Tetrafluoride:* - Involves the transfer of a fluoride ion, making the carbonyl compound fluorinated.
These halogenation reactions, whether involving chlorine or fluorine, are pivotal in organic chemistry. They alter the molecular structure and thus the chemical behavior of the resulting compounds. Understanding these mechanisms allows chemists to purposefully modify molecules for desired functions and properties in various applications.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Write a reasonable mechanism for the reaction of hydrogen chloride and methanol with formaldehyde to give methy1 chloromethy1 ether that is consistent with the fact that the reaction occurs under conditions where neither methylene chloride nor methy1 chloride are formed.

Semicarbazide ( 1 mole ) is added to a mixture of cyclohexanone ( 1 mole) and benzaldehyde ( 1 mole). If the product is isolated immediately, it consists almost entirely of the semicarbazone of cyclohexanone; if the product is isolated after several hours, it consists almost entirely of the semicarbazone of benzaldehyde. How do you account for these observations?

Assume that an equimolar mixture of formaldehyde and trimethylacetaldehyde (each undergoes the Cannizzaro reaction by itself) is heated with sodium hydroxide solution. Write equations for the various possible combinations of Cannizzaro reactions which might occur. Would you expect formaldehyde used in excess to primarily reduce or oxidize trimethylacetaldehyde? Why?

One of the compounds that was initially formed in the primitive atmosphere was formaldehyde (H2C=0). It is one of the precursor molecules that came to make up living organisms. It can be formed photolytically as shown in the following equation: CH4+H2O(hv)H2C=O+4H Propose a mechanism for this reaction.

A certain test for aldehydes and most ketones depends upon a color-change when the compound is added to a solution of hydroxylamine hydrochloride and an acid-base indicator. Explain the basis of this test.

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.

Sign-up for free