Chapter 19: Problem 47
Draw structural formulas and give the systematic names for at least four isomeric hydrocarbons containing seven carbon atoms and one double bond.
Short Answer
Expert verified
The four isomeric hydrocarbons containing seven carbon atoms and one double bond are:
1. CH2=CH-CH2-CH2-CH2-CH2-CH3: \(1-heptene\)
2. CH3-CH2=CH-CH2-CH2-CH2-CH3: \(2-heptene\)
3. CH2=CH-CH(CH3)-CH2-CH2-CH2-CH3: \(3-methyl-1-heptene\)
4. CH2=CH-CH(CH3)-CH2-CH2-CH2-CH3 | CH3: \(2-methyl-1-hexene\)
Step by step solution
01
Understand Isomeric Hydrocarbons and Hydrocarbon Nomenclature
Isomeric hydrocarbons are hydrocarbons (compounds consisting of only hydrogen and carbon) that have the same molecular formula but different structural formulas. In our case, the molecular formula is C7H14 because there are seven carbon atoms and one double bond.
To name hydrocarbons systematically, we will use the International Union of Pure and Applied Chemistry (IUPAC) guidelines. The naming process involves identifying the longest continuous carbon chain containing the double bond, and then numbering the carbons in the chain, starting with the carbon closest to the double bond. The prefix for the parent chain indicates the number of carbon atoms, and the suffix "-ene" indicates the presence of a double bond.
Now, let's draw the structural formulas and provide systematic names for the four isomeric hydrocarbons.
02
Draw the first isomer
The first isomer will have a straight chain of seven carbon atoms with the double bond between carbons 1 and 2. The structural formula is listed below:
CH2=CH-CH2-CH2-CH2-CH2-CH3
The IUPAC name for this isomer would be \(1-heptene\).
03
Draw the second isomer
In the second isomer, the double bond will be between carbons 2 and 3 in the longest carbon chain. The structural formula is given below:
CH3-CH2=CH-CH2-CH2-CH2-CH3
The IUPAC name for this isomer would be \(2-heptene\).
04
Draw the third isomer
For the third isomer, we will introduce a branched structure. The longest chain containing the double bond will still have seven carbon atoms, with the double bond between carbons 1 and 2. A methyl group (CH3) will be attached to carbon 3, creating a branched structure. The structural formula can be represented as follows:
CH2=CH-CH(CH3)-CH2-CH2-CH2-CH3
The IUPAC name for this isomer would be \(3-methyl-1-heptene\).
05
Draw the fourth isomer
The fourth isomer will also have a branched structure, with the longest carbon chain containing the double bond consisting of six carbon atoms and the double bond extending between carbons 1 and 2. A methyl group (CH3) will be attached to carbon 2, creating a branched structure. The structural formula is given below:
CH2=CH-CH(CH3)-CH2-CH2-CH2-CH3 | CH3
The IUPAC name for this isomer would be \(2-methyl-1-hexene\).
In conclusion, here are the structural formulas and systematic names for at least four isomeric hydrocarbons containing seven carbon atoms and one double bond:
1. CH2=CH-CH2-CH2-CH2-CH2-CH3: \(1-heptene\)
2. CH3-CH2=CH-CH2-CH2-CH2-CH3: \(2-heptene\)
3. CH2=CH-CH(CH3)-CH2-CH2-CH2-CH3: \(3-methyl-1-heptene\)
4. CH2=CH-CH(CH3)-CH2-CH2-CH2-CH3 | CH3: \(2-methyl-1-hexene\)
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with Vaia!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Hydrocarbon Nomenclature
When tackling the complex world of organic chemistry, the hydrocarbon nomenclature is foundational. It's the system we use to name various hydrocarbon molecules, which consist solely of hydrogen and carbon atoms. Hydrocarbons form the backbone of organic chemistry and can be categorized as alkanes (single bonds), alkenes (one or more double bonds), and alkynes (one or more triple bonds).
Understanding the structure of hydrocarbons is crucial before naming them. They can have straight chains (linear), branches, or even form rings (cyclic). More complex hydrocarbons may include multiple functional groups that can significantly influence the molecule's properties and its name.
When faced with a problem, such as naming isomeric hydrocarbons with seven carbon atoms and one double bond, the first step is to decipher the types of chains and the location of the double bond. Recognize that different arrangements of atoms (isomers) with the same molecular formula can have different names. This knowledge serves as a foundation for mastering the IUPAC naming system and correctly classifying myriad structures encountered in organic chemistry.
Understanding the structure of hydrocarbons is crucial before naming them. They can have straight chains (linear), branches, or even form rings (cyclic). More complex hydrocarbons may include multiple functional groups that can significantly influence the molecule's properties and its name.
When faced with a problem, such as naming isomeric hydrocarbons with seven carbon atoms and one double bond, the first step is to decipher the types of chains and the location of the double bond. Recognize that different arrangements of atoms (isomers) with the same molecular formula can have different names. This knowledge serves as a foundation for mastering the IUPAC naming system and correctly classifying myriad structures encountered in organic chemistry.
IUPAC Naming System
The IUPAC naming system is a universal language for describing the structure of organic compounds. The International Union of Pure and Applied Chemistry designed these rules to standardize chemical nomenclature across the world. A deep dive into the IUPAC guidelines reveals the importance of identifying the longest carbon chain, selecting the correct suffixes and prefixes, and using locants to mark positions of specific groups or bonds.
For alkenes, the carbon chain must include the double bond, and it's numbered such that the double bond gets the lowest possible locants. The name of the compound ends with '-ene' to denote the presence of a double bond. When branching occurs, as seen in isomers with side groups like methyl, ethyl, etc., these are prefixed to the name in alphabetical order with their respective carbon number. Through practice and familiarity with these rules, the naming process becomes intuitive, helping students to communicate complex structures simply and accurately.
For alkenes, the carbon chain must include the double bond, and it's numbered such that the double bond gets the lowest possible locants. The name of the compound ends with '-ene' to denote the presence of a double bond. When branching occurs, as seen in isomers with side groups like methyl, ethyl, etc., these are prefixed to the name in alphabetical order with their respective carbon number. Through practice and familiarity with these rules, the naming process becomes intuitive, helping students to communicate complex structures simply and accurately.
Structural Formulas
The structural formulas in organic chemistry are more than just a collection of letters and dashes; they're a window into the molecule's geometric dimensions. These visual representations show how atoms are bonded in a molecule and are crucial for understanding chemical behavior. Drawing structural formulas, as required for isomeric hydrocarbons, involves making decisions about the placement of atoms and the type of chemical bonds.
For hydrocarbons with multiple isomers, such as those with seven carbons and one double bond, each unique arrangement leads to a different structural formula. A continuous line of carbon atoms might represent the backbone, while branching is shown by drawing lines to indicate side-chain locations. It's essential to remember that every different structural formula represents a distinct molecule with potentially varying physical and chemical properties, despite having the same molecular formula.
For hydrocarbons with multiple isomers, such as those with seven carbons and one double bond, each unique arrangement leads to a different structural formula. A continuous line of carbon atoms might represent the backbone, while branching is shown by drawing lines to indicate side-chain locations. It's essential to remember that every different structural formula represents a distinct molecule with potentially varying physical and chemical properties, despite having the same molecular formula.
Organic Chemistry
Organic Chemistry, often dubbed as the 'chemistry of life,' deals with the study of the structure, properties, composition, reactions, and synthesis of organic compounds primarily composed of carbon atoms in various forms. It touches every aspect of our daily lives, from the pharmaceuticals that keep us healthy to the plastics that are ubiquitous in our surroundings.
In organic chemistry, the focus is not only on naming and identifying the compounds but also on understanding how different atoms interact and bond to form these complex structures. The exploration of isomers and structural formulas certainly emphasizes the depth and variety possible within organic molecules. By learning to recognize distinctive arrangements and how they are transformed during chemical reactions, students gain powerful tools for innovating new materials and solving biological challenges. Overall, organic chemistry is a vast and fascinating field where a strong grasp of fundamental concepts like hydrocarbon nomenclature, the IUPAC system, and structural formulas can lead to remarkable discoveries and applications.
In organic chemistry, the focus is not only on naming and identifying the compounds but also on understanding how different atoms interact and bond to form these complex structures. The exploration of isomers and structural formulas certainly emphasizes the depth and variety possible within organic molecules. By learning to recognize distinctive arrangements and how they are transformed during chemical reactions, students gain powerful tools for innovating new materials and solving biological challenges. Overall, organic chemistry is a vast and fascinating field where a strong grasp of fundamental concepts like hydrocarbon nomenclature, the IUPAC system, and structural formulas can lead to remarkable discoveries and applications.