Question

The IUPAC name of is CCC(C=O)CC(C)C (a) 2 -ethyl-4-methylpentanal (b) 4 -methyl 2 -ethylpentanal (c) 2 -methylhexanal (d) 2 -ethylhexanal

Short answer

Answer: (a) 2-ethyl-4-methylpentanal

Step-by-step solution

Convert the SMILES notation to its structural formula

The SMILES notation given is "CCC(C=O)CC(C)C". We will convert this notation to its structural formula by following these steps: 1. Identify the main chain of carbon atoms: "CCC". 2. Branches and groups are represented by symbols enclosed in parentheses: "C=O" is an aldehyde group, and "C(C)C" indicates there is a side-chain methyl group. 3. Put everything together to get the structural formula: CH3-CH2-CH(CH3)-CH(C=O)-CH2-CH3

Identify and number the longest carbon chain

Now that we have the structural formula, we need to identify the longest carbon chain and number it according to the IUPAC naming rules. In this case, our longest carbon chain is a continuous chain of 6 carbons: CH3-CH2-CH(CH3)-CH(C=O)-CH2-CH3 1 2 3 4 5 6

Identify and label functional groups and side chains

With the carbon chain numbered, we can now identify and label any functional groups and side chains: 1. Aldehyde group (C=O) at carbon 5: pentanal (base name) 2. Methyl group (-CH3) at carbon 4: 4-methyl 3. Ethyl group (-CH2-CH3) at carbon 2: 2-ethyl

Combine the labels to form the IUPAC name

Finally, we can combine all the labels in the order of functional group/base name, followed by the side chains with their respective positions, in alphabetical order: 2-ethyl-4-methylpentanal Based on our analysis, the correct IUPAC name for the given SMILES notation is (a) 2-ethyl-4-methylpentanal.