Question

Give the structural formula of two different dipeptides formed between arginine and serine.

Short answer

Answer: The two different dipeptides formed between arginine and serine are Arginylserine and Serylarginine. Their structural formulae are as follows: Arginylserine: NH2-CH(COOH)-NH-CH2-CH2-CH2-NH-C(NH)-NH2 || NH2-CH(COOH)-CH2-OH Serylarginine: NH2-CH(COOH)-CH2-OH || NH2-CH(COOH)-NH-CH2-CH2-CH2-NH-C(NH)-NH2

Step-by-step solution

Structure of Arginine and Serine

Firstly, let's write the structures of arginine and serine: Arginine: NH2-CH(COOH)-NH-CH2-CH2-CH2-NH-C(NH)-NH2 Serine: NH2-CH(COOH)-CH2-OH Now, we will combine these individual amino acids by creating a dipeptide with peptide bonds in two different ways.

Formation of Dipeptide 1

To form dipeptide 1, we will create a peptide bond between the amino group of arginine and the carboxyl group of serine: Arginine-Serine peptide: NH2-CH(COOH)-NH-CH2-CH2-CH2-NH-C(NH)-NH2 || NH2-CH(COOH)-CH2-OH The dipeptide 1 is called Arginylserine.

Formation of Dipeptide 2

To form dipeptide 2, we will create a peptide bond between the amino group of serine and the carboxyl group of arginine: Serine-Arginine peptide: NH2-CH(COOH)-CH2-OH || NH2-CH(COOH)-NH-CH2-CH2-CH2-NH-C(NH)-NH2 The dipeptide 2 is called Serylarginine. In conclusion, the two different dipeptides formed between arginine and serine are Arginylserine and Serylarginine with the respective dipeptide structures given above.