Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Determine ΔH comb  for butanoic acid, C3H7COOH(1)+5O2(g)4CO2(g)+4H2O(l) Use data in Table R -11 on page 975 and the following equation. 4C(s)+4H2(g)+O2(g)C3H7COOH(1)ΔH=534kJ

Short Answer

Expert verified
The standard enthalpy of combustion for butanoic acid (ΔH_comb) can be calculated using Hess's Law and the given information: ΔH_comb = 534 kJ + (-1574 kJ) + (-1143.2 kJ) = -2183.2 kJ.

Step by step solution

01

1. Balanced equation for butanoic acid combustion

Write down the given balanced equation for the combustion reaction of butanoic acid: C₃H₇COOH(l) + 5 O₂(g) → 4 CO₂(g) + 4 H₂O(l)
02

2. Balanced equation for butanoic acid formation

Write down the given balanced equation for the formation of butanoic acid from its elements: 4 C(s) + 4 H₂(g) + O₂(g) → C₃H₇COOH(l) ΔH = -534 kJ
03

3. Enthalpy of formation values from Table R-11

We will need the enthalpies of formation (∆Hf) for O₂(g), CO₂(g), and H₂O(l) from Table R-11 on page 975: - ∆Hf O₂(g): 0 kJ/mol - ∆Hf CO₂(g): -393.5 kJ/mol - ∆Hf H₂O(l): -285.8 kJ/mol
04

4. Hess's Law calculation

We can calculate the enthalpy of combustion using Hess's Law. Let's set up the balanced equations and their enthalpy changes below: (i) C₃H₇COOH(l) + 5 O₂(g) → 4 CO₂(g) + 4 H₂O(l) ΔH_comb (ii) 4 C(s) + 4 H₂(g) + O₂(g) → C₃H₇COOH(l) ΔH = -534 kJ Now, we need to manipulate equation (ii) to match the products formed during the combustion reaction. We reverse the equation and change the sign of the enthalpy change: (iii) C₃H₇COOH(l) → 4 C(s) + 4 H₂(g) + O₂(g) ΔH = 534 kJ We can now add equation (iii) to the enthalpy equations of the combustion products: (iv) 4 C(s) + 4 H₂(g) + O₂(g) → 4 CO₂(g) ΔH = 4*(-393.5 kJ/mol) = -1574 kJ (v) 4 H₂(g) + 2 O₂(g) → 4 H₂O(l) ΔH = 4*(-285.8 kJ/mol) = -1143.2 kJ Summing (iv) and (v) gives us the enthalpy of combustion (∆H_comb) equation: (vi) C₃H₇COOH(l) + 5 O₂(g) → 4 CO₂(g) + 4 H₂O(l) Now we can sum the enthalpy values from equations (iii), (iv), and (v) to get the enthalpy of combustion for butanoic acid: ∆H_comb = 534 kJ + (-1574 kJ) + (-1143.2 kJ) = -2183.2 kJ
05

5. Conclusion

The standard enthalpy of combustion for butanoic acid (ΔH_comb) is -2183.2 kJ.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Hess's Law
If you've ever combined a couple of easy math problems to get a new result, you've done something similar to what Hess's Law does for chemical reactions. Hess's Law is like a clever accountant that lets us add and subtract thermodynamic equations to find the heat change for a particular reaction.
In essence, Hess's Law states that the total enthalpy change for a given chemical reaction is the same, no matter how many steps the reaction is carried out in. That means if you can figure out a series of reactions that add up to your desired reaction, you can calculate the total enthalpy change by adding up the enthalpy changes of each step.
This is incredibly useful for measuring enthalpy changes when a direct measurement would be difficult or impossible. In practice, you use Hess's Law by doing the following:
  • Select or create equations that, when summed, will match the products and reactants of your target reaction.
  • If you reverse any equation (flip reactants and products), remember to change the sign of the enthalpy value.
  • Add the enthalpies together to find the enthalpy change for your target reaction.
For example, in the combustion of butanoic acid, you use Hess's Law to rearrange and sum several reactions to find the total enthalpy of combustion, even if we cannot simply measure it directly.
Enthalpy of Formation
The enthalpy of formation is a key concept for anyone diving into the world of thermodynamics. It represents the heat change that occurs when one mole of a compound is formed from its elements in their standard states.
Knowing this value is essential because it helps us calculate the enthalpy changes of more complex reactions when used in combination with Hess's Law. Standard states refer to the pure form of a substance at 1 atm pressure and typically at 25°C. For example, the standard enthalpy of formation for butanoic acid is given as 534kJ/mol. This tells us about the energy released when forming butanoic acid from carbon, hydrogen, and oxygen in their natural states.
Recall that:
  • The enthalpy of formation for any element in its standard state is zero.
  • We use known enthalpy values for reactants and products to solve for unknowns in reactions.

Understanding and using enthalpies of formation is crucial in piecing together the puzzle of how different substances interact and the energy changes they undergo during chemical reactions.
Butanoic Acid Combustion
Let's talk about the combustion process of butanoic acid, a chemical reaction that involves burning a substance in the presence of oxygen to produce carbon dioxide and water. It's an exothermic reaction, meaning it releases heat.
The balanced combustion equation for butanoic acid is:C3H7COOH()+5O2(g)4CO2(g)+4H2O()
When solving for the enthalpy of combustion, we need to consider the energy changes of all substances involved. This includes the formation of water and carbon dioxide from oxygen and hydrogen, and carbon, respectively.
In the context of our problem, we use Hess's Law to manipulate formation and combustion reactions of butanoic acid and its elemental components. The given reaction and enthalpy values guide us in calculating the total energy change.
After applying Hess's Law and combining relevant reactions, the enthalpy of combustion for butanoic acid is determined to be 2183.2kJ/mol. This negative value signifies the release of energy, reinforcing that combustion is exothermic, a characteristic shared by all burning processes.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.

Sign-up for free