Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Problem 34

a. Why is the following reaction called a combination reaction? H2(g)+Br2(g)2HBr(g) b. Why is the following reaction called a double replacement reaction? AgNO3(aq)+NaCl(aq)AgCl(s)+NaNO3(aq)

Problem 35

Classify each of the following reactions as a combination, decomposition, single replacement, double replacement, or combustion: a. 4Fe(s)+3O2(g)2Fe2O3(s) b. Mg(s)+2AgNO3(aq)Mg(NO3)2(aq)+2Ag(s) c. CuCO3(s)ΔCuO(s)+CO2(g) d. NaOH(aq)+HCl(aq)NaCl(aq)+H2O(t) e. ZnCO3(s)ΔCO2(g)+ZnO(s) f. Al2(SO4)3(aq)+6KOH(aq) 2Al(OH)3(s)+3 K2SO4(aq) gPb(s)+O2(g)PbO2(s) h. C4H8(g)+6O2(g)Δ4CO2(g)+4H2O(g)

Problem 36

Classify each of the following reactions as a combination, decomposition, single replacement, double replacement, or combustion: a. CuO(s)+2HCl(aq)CuCl2(aq)+H2O(l) b. 2Al(s)+3Br2(g)2AlBr3(s) c. Pb(NO3)2(aq)+2NaCl(aq)PbCl2(s)+2NaNO3(aq) d. 2Mg(s)+O2(g)Δ2MgO(s) e. 2C2H2(g)+5O2(g)Δ4CO2(g)+2H2O(g) f. Fe2O3(s)+3C(s)2Fe(s)+3CO(g) g. C6H12O6(aq)2C2H6O(aq)+2CO2(g) h. BaCl2(aq)+K2CO3(aq)BaCO3(s)+2KCl(aq)

Problem 37

Predict the products that would result from each of the following reactions and balance: a. combination: Mg(s)+Cl2(g) b. decomposition: HBr(g)Δ c. single replacement: Mg(s)+Zn(NO3)2(aq) d. double replacement: K2 S(aq)+Pb(NO3)2(aq) e. combustion: C2H6(g)+O2(g)Δ

Problem 38

Predict the products that would result from each of the following reactions and balance: a. combination: Ca(s)+O2(g) b. combustion: C6H6(g)+O2(g)Δ c. decomposition: PbO2(s)Δ d. single replacement: KI(s)+Cl2(g) e. double replacement: CuCl2(aq)+Na2 S(aq)

Problem 39

Indicate each of the following as an oxidation or a reduction: a. Na+(aq)+eNa(s) b. Ni(s)Ni2+(aq)+2e c. Cr3+(aq)+3eCr(s) d. 2H+(aq)+2eH2(g)

Problem 40

Indicate each of the following as an oxidation or a reduction: a. O2(g)+4e2O2(aq) b. Al(s)Al3+(aq)+3e c. Fe3+(aq)+eFe2+(aq) d. 2Br(aq)Br2(l)+2e

Problem 41

In each of the following reactions, identify the reactant that is oxidized and the reactant that is reduced: a. Zn(s)+Cl2(g)ZnCl2(s) b. Cl2(g)+2NaBr(aq)2NaCl(aq)+Br2(l) c. 2PbO(s)2 Pb(s)+O2(g) d. 2Fe3+(aq)+Sn2+(aq)2Fe2+(aq)+Sn4+(aq)

Problem 42

In each of the following reactions, identify the reactant that is oxidized and the reactant that is reduced: a. 2Li(s)+F2(g)2LiF(s) b. Cl2(g)+2KI(aq)2KCl(aq)+I2(s) c. 2Al(s)+3Sn2+(aq)2Al3+(aq)+3Sn(s) d. Fe(s)+CuSO4(aq)FeSO4(aq)+Cu(s)

Problem 43

In the mitochondria of human cells, energy for the production of ATP is provided by the oxidation and reduction reactions of the iron ions in the cytochromes in electron transport. Identify each of the following reactions as an oxidation or reduction: a. Fe3++eFe2+ b. Fe2+Fe3++e

Access millions of textbook solutions in one place

  • Access over 3 million high quality textbook solutions
  • Access our popular flashcard, quiz, mock-exam and notes features
  • Access our smart AI features to upgrade your learning
Get Vaia Premium now
Access millions of textbook solutions in one place

Recommended explanations on Chemistry Textbooks