Chapter 15: Problem 56
Repeat the procedure in Exercise 55 , but for the titration of \(25.0 \mathrm{~mL}\) of \(0.100 M\) propanoic acid \(\left(\mathrm{HC}_{3} \mathrm{H}_{3} \mathrm{O}_{2}, K_{\mathrm{a}}=1.3 \times 10^{-5}\right)\) with \(0.100 \mathrm{M} \mathrm{NaOH}\).
Short Answer
Expert verified
In the titration of 25.0 mL of 0.100 M propanoic acid with 0.100 M NaOH, the pH values at different points are as follows:
1. Initial pH before titration: \(2.44\)
2. pH at the half-equivalence point: \(4.89\)
3. pH at the equivalence point: \(9.09\)
Step by step solution
01
1. Calculating initial pH before titration
To find the initial pH of the propanoic acid solution, we need to use the given Ka value and set up an ICE table:
HC3H3O2(aq) + H2O(l) ↔ C3H3O2^–(aq) + H3O^+(aq)
Initially: [HC3H3O2] = 0.100 M, [C3H3O2-] = 0 M, [H3O+] = 0 M
Change: -x, +x, +x
Finally: 0.100 - x, x, x
Kₐ = [C3H3O2-][H3O+]/[HC3H3O2] = (x)(x) / (0.100 - x)
Since Kₐ is very small, we can approximate that x<<0.100 and simplify the equation:
Kₐ = x^2/0.100
Now, solve for x:
x = √(Kₐ * 0.100) = √(1.3 * 10^(-5) * 0.100)
x = 3.594 × 10^⁻³ M
The initial [H3O+] = x, and we can find the initial pH:
pH = -log([H3O+]) = -log(3.594 × 10^⁻³) ≈ 2.44
02
2. Determining the pH at half-equivalence point
At the half-equivalence point, the amount of NaOH added will be half the amount of propanoic acid. In this context, [HC3H3O2] = [C3H3O2-], and the pH value would be equal to the pKa of propanoic acid. To calculate the pKa:
pKa = -log(Kₐ) = -log(1.3 × 10^-5) ≈ 4.89
So the pH at the half-equivalence point is 4.89.
03
3. Calculating the pH at the equivalence point
At the equivalence point, all of the propanoic acid has reacted with the NaOH. To calculate the moles of propanoic acid and NaOH in the solution:
moles_propanoic_acid = 0.100 M × 25.0 mL = 0.00250 mol
Since there's a 1:1 reaction between propanoic acid and NaOH, we need 0.00250 mol of NaOH.
volume_NaOH = moles_NaOH / concentration_NaOH = 0.00250 mol / 0.100 M = 25 mL
Now, we have 25 mL of propanoic acid and 25 mL of NaOH mixed, so the total solution volume is 50 mL. At the equivalence point, all the propanoic acid has been converted to its conjugate base, the C3H3O2- ion:
[C3H3O2-] = 0.00250 mol / 50.0 mL = 0.0500 M
Now we calculate the hydroxide ion concentration [OH-] produced by the C3H3O2- ion. We also need the Kb value of the conjugate base, which can be found using the relationship Ka × Kb = Kw = 1.0 × 10^⁻¹⁴:
Kb = Kw/Ka = (1.0 × 10^⁻¹⁴) / (1.3 × 10^⁻⁵) = 7.69 × 10^⁻¹⁰
Now we set up an ICE table for C3H3O2- reacting with water:
C3H3O2^–(aq) + H2O(l) ↔ HC3H3O2(aq) + OH^–(aq)
Initially: [C3H3O2-] = 0.0500 M, [HC3H3O2] = 0 M, [OH-] = 0 M
Change: -x, +x, +x
Finally: 0.0500 - x, x, x
Kb = [HC3H3O2][OH-]/[C3H3O2-] = (x)(x) / (0.0500 - x)
Since Kb is very small, we can approximate that x<<0.0500 and simplify the equation:
Kb = x^2/0.0500
Now, solve for x:
x = √(Kb * 0.0500) = √(7.69 × 10^⁻¹⁰ * 0.0500)
x = 1.22 × 10^⁻⁵ M
The [OH-] = x, and we can find the pOH:
pOH = -log([OH-]) = -log(1.22 × 10^⁻⁵) ≈ 4.91
To find the pH:
pH = 14 - pOH = 14 - 4.91 ≈ 9.09
The pH at the equivalence point is 9.09.
#Results#
The pH at different points in the titration curve is as follows:
1. Initial pH before titration: 2.44
2. pH at the half-equivalence point: 4.89
3. pH at the equivalence point: 9.09
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with Vaia!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Acid-Base Titration
Understanding acid-base titration is pivotal for students tackling exercises like titrating propanoic acid with NaOH. This process involves slowly adding one solution of a known concentration (titrant) to another solution of unknown concentration or vice versa, until the chemical reaction is completed. The titrant is usually a strong acid or base, making it easier to determine the end of the reaction.
In the given exercise, the titration involves a weak acid, propanoic acid (HC3H5O2), and a strong base, Sodium Hydroxide (NaOH). The goal is to neutralize the weak acid with the strong base. This acid-base neutralization reaction forms water (H2O) and a salt, in this case, sodium propanoate (NaC3H5O2). As the titrant is added, the concentration of hydrogen ions (H3O+) in the solution decreases, leading to a change in the pH, which can be measured with a pH meter or an indicator.
To reach the 'equivalence point' of the titration, where stoichiometrically equivalent quantities of acid and base have reacted, one must precisely measure the volume of titrant added. For weak acid-strong base titrations, the equivalence point will usually have a pH greater than 7 due to the production of the conjugate base of the weak acid, which slightly ionizes in water, creating a basic solution.
In the given exercise, the titration involves a weak acid, propanoic acid (HC3H5O2), and a strong base, Sodium Hydroxide (NaOH). The goal is to neutralize the weak acid with the strong base. This acid-base neutralization reaction forms water (H2O) and a salt, in this case, sodium propanoate (NaC3H5O2). As the titrant is added, the concentration of hydrogen ions (H3O+) in the solution decreases, leading to a change in the pH, which can be measured with a pH meter or an indicator.
To reach the 'equivalence point' of the titration, where stoichiometrically equivalent quantities of acid and base have reacted, one must precisely measure the volume of titrant added. For weak acid-strong base titrations, the equivalence point will usually have a pH greater than 7 due to the production of the conjugate base of the weak acid, which slightly ionizes in water, creating a basic solution.
Equivalence Point
The equivalence point in a titration is a critical juncture, which occurs when the moles of titrant added equals the moles of substance present in the solution being titrated. This is the point at which neutralization is achieved and is characterized by a sharp change in pH, which can be visually detected with the help of an indicator or by using a pH meter.
In the titration of propanoic acid with NaOH, the equivalence point is when all propanoic acid molecules have reacted with the sodium hydroxide to form water and sodium propanoate. It's important to note that, for a weak acid-strong base titration, the pH at the equivalence point will not be neutral (pH of 7). This is because the conjugate base of the weak acid (C3H5O2-) has a basic character and will slightly increase the pH above neutral. As demonstrated in the solution provided, calculating the pH at the equivalence point involves understanding the basicity of the conjugate base and the total volume of the solution after titration.
In the titration of propanoic acid with NaOH, the equivalence point is when all propanoic acid molecules have reacted with the sodium hydroxide to form water and sodium propanoate. It's important to note that, for a weak acid-strong base titration, the pH at the equivalence point will not be neutral (pH of 7). This is because the conjugate base of the weak acid (C3H5O2-) has a basic character and will slightly increase the pH above neutral. As demonstrated in the solution provided, calculating the pH at the equivalence point involves understanding the basicity of the conjugate base and the total volume of the solution after titration.
pH Calculation
pH calculation is a fundamental aspect of acid-base chemistry. The pH scale is logarithmic, meaning each whole pH value below 7 is ten times more acidic than the next higher value. Calculation of pH often involves using the equation (pH = -log[H3O+]), where [H3O+] is the concentration of hydronium ions in the solution.
In the context of the titration problem provided, the pH calculations vary depending on the stage of the titration. Before the titration begins, the initial pH is calculated based on the dissociation of propanoic acid in water. At the half-equivalence point, the pH equals the pKa, since the concentrations of the acid and its conjugate base are equal. This is a unique buffer region where the solution can resist changes in pH. Finally, at the equivalence point, the pH is determined by the concentration of the newly formed conjugate base, requiring the usage of Kb and ICE tables to find the concentration of OH- ions and, subsequently, the pH. This variation of pH throughout the titration is what forms the basis of the titration curve, where the Y-axis represents the pH and the X-axis shows the volume of titrant added.
In the context of the titration problem provided, the pH calculations vary depending on the stage of the titration. Before the titration begins, the initial pH is calculated based on the dissociation of propanoic acid in water. At the half-equivalence point, the pH equals the pKa, since the concentrations of the acid and its conjugate base are equal. This is a unique buffer region where the solution can resist changes in pH. Finally, at the equivalence point, the pH is determined by the concentration of the newly formed conjugate base, requiring the usage of Kb and ICE tables to find the concentration of OH- ions and, subsequently, the pH. This variation of pH throughout the titration is what forms the basis of the titration curve, where the Y-axis represents the pH and the X-axis shows the volume of titrant added.