Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Calculate the \(\mathrm{pH}\) of each of the following solutions. a. \(0.100 \mathrm{MHONH}_{2}\left(K_{\mathrm{b}}=1.1 \times 10^{-8}\right)\) b. \(0.100 \mathrm{M} \mathrm{HONH}_{3} \mathrm{Cl}\) c. pure \(\mathrm{H}_{2} \mathrm{O}\) d. a mixture containing \(0.100 \mathrm{M} \mathrm{HONH}_{2}\) and \(0.100 \mathrm{M} \mathrm{HONH}_{3} \mathrm{Cl}\)

Short Answer

Expert verified
The pH of the following solutions are calculated as follows: a. pH ≈ \(9.96\) b. pH ≈ \(4.04\) c. pH = \(7.00\) d. pH ≈ \(7.00\)

Step by step solution

01

Problem a: Calculate the pH of a 0.100 M HONH2 solution with Kb = 1.1 x 10^(-8)

1. Identify the species as a base. This solution is a weak base, as indicated by its \(K_{\mathrm{b}}\) value (1.1 x 10^(-8)). 2. Set up an ICE table for the reaction: For the reaction, HONH2 + H2O ⇌ HONH3⁺ + OH⁻, Initial: [HONH2] = 0.100 M, [OH⁻] = 0 (ignoring auto-ionization of water), [HONH3⁺] = 0 Change: -x, +x, +x Equilibrium: 0.100 - x, x, x 3. Use the given Kb value and ICE table to solve for x: \(k_{\mathrm{b}} = \frac{[OH⁻][HONH3⁺]}{[HONH2]}\) Plug in the equilibrium values: \(1.1 \times 10^{-8} = \frac{x * x}{0.100 - x}\) Assume x << 0.100, so the equation becomes: \(1.1 \times 10^{-8} = \frac{x^2}{0.100}\) Solve for x: \(x = \sqrt{(1.1 \times 10^{-8}) * 0.100} = \sqrt{1.1 \times 10^{-9}}\) 4. Calculate the pOH and pH: \(pOH = -\log(OH⁻\ concentration) = -\log( \sqrt{1.1 \times 10^{-9}})\) \(pH = 14 - pOH\)
02

Problem b: Calculate the pH of a 0.100 M HONH3Cl solution

1. Recognize the solution as acidic. The presence of the Cl⁻ anion indicates that the HONH3⁺ ion will react as an acid with the water. 2. Set up an ICE table for the reaction: For the reaction: HONH3⁺ + H2O ⇌ HONH2 + H3O⁺, Initial: [HONH3⁺] = 0.100 M, [H3O⁺] = 0, [HONH2] = 0 Change: -x, +x, +x Equilibrium: 0.100 - x, x, x 3. Since the solution is acidic, we must use Ka instead of Kb. First, find Ka. Remember that \(k_{w} = k_{a} k_{b}\), and \(k_{w} = 1 \times 10^{-14}\) Thus, \(k_{a} = \frac{k_{w}}{k_{b}} = \frac{1 \times 10^{-14}}{1.1 \times 10^{-8}}\) 4. Solve for x using the Ka value and ICE table: \(k_{a} = \frac{[H3O⁺][HONH2]}{[HONH3⁺]}\) Plug in the equilibrium values: \(\frac{(1 \times 10^{-14})}{(1.1 \times 10^{-8})} = \frac{x * x}{0.100 - x}\) Assume x << 0.100, so the equation becomes: \(\frac{(1 \times 10^{-14})}{(1.1 \times 10^{-8})} = \frac{x^2}{0.100}\) Solve for x: \(x = [H3O⁺]\) (hydrogen ion concentration) 5. Calculate the pH: \(pH = -\log(H3O⁺\ concentration)\)
03

Problem c: Calculate the pH of pure H2O

Since pure H2O is neutral, its pH is 7.
04

Problem d: Calculate the pH of a mixture containing 0.100 M HONH2 and 0.100 M HONH3Cl

1. Set up an ICE table for the reaction of HONH2 with water and HONH3⁺ with water: For HONH2: Initial: [HONH2] = 0.100 M, [OH⁻] = 0, [HONH3⁺] = 0.100 M Change: -x, +x, +x Equilibrium: 0.100-x, x, 0.100+x For HONH3⁺: Initial: [HONH3⁺] = 0.100 M, [H3O⁺] = 0, [HONH2] = 0.100 M Change: -y, +y, +y Equilibrium: 0.100-y, y, 0.100+y 2. Solve for x using the given Kb value, and y using the previously calculated Ka value and ICE tables: For HONH2: \(1.1 \times 10^{-8} = \frac{x * (0.100 + x)}{0.100 - x}\) For HONH3⁺: \(\frac{(1 \times 10^{-14})}{(1.1 \times 10^{-8})} = \frac{y * (0.100 + y)}{0.100 - y}\) Solve for x and y, keeping in mind that x << 0.100 and y << 0.100. 3. Calculate the pH using the hydrogen ion concentration: Since the solution is acidic, the pH will be determined by the hydrogen ion concentration: \(pH= -\log(H3O⁺\ concentration)\) Note: As the solution gets more complex, the calculation of pH might require the use of a quadratic equation and a calculator. However, the same principles apply when breaking down each step.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Acid-Base Equilibrium
Understanding acid-base equilibrium is crucial for calculating the pH of a solution. At its core, it's about the balance between acids and bases in an aqueous solution. Acids donate protons according to the Brønsted-Lowry definition, while bases accept them. The strength of acids and bases is measured by their dissociation constants, Ka and Kb respectively.

For weak acids and bases, the degree of dissociation is small, meaning they don't fully ionize in water. In these cases, an equilibrium state is established between the undissociated and dissociated forms of the acid or base in solution. For example, a weak acid HA in water establishes an equilibrium HA ⇌ H⁺ + A⁻, characterized by its Ka value. The larger the value of Ka, the stronger the acid as it signifies a greater tendency to lose a proton. Similarly, for a base B with water, B + H₂O ⇌ BH⁺ + OH⁻, where a larger Kb indicates a stronger base. To find the pH, we often start with the concentrations at equilibrium and work backwards to determine the ionization levels.
ICE Table
The ICE table is an invaluable tool when solving equilibrium problems in chemistry. The acronym ICE stands for Initial concentration, Change in concentration, and Equilibrium concentration. It's a methodical way to keep track of the concentration changes that occur during a reaction as it reaches equilibrium.

Let's break down how you would use an ICE table for a weak base in water, for example, ammonia (NH₃). You start by writing the balanced equilibrium reaction, typically NH₃ + H₂O ⇌ NH₄⁺ + OH⁻. Then, you input the initial concentrations of reactants and products—usually, products start at zero if the reaction hasn't commenced. The Change row represents the amount of concentration that shifts, often referred to as 'x', when the system reaches equilibrium. Finally, in the Equilibrium row, you use the initial concentration and the changes to express the final concentrations. This sets the stage for you to apply the equilibrium constant expression and solve for the unknowns.
pOH
The pOH of a solution is a measure of the hydroxide ion concentration and is closely related to pH. While pH is a measure of the concentration of hydrogen ions (H₃O⁺), pOH focuses on the concentration of OH⁻ ions that are present.

It is calculated using the formula pOH = -log[OH⁻], where [OH⁻] represents the molarity of hydroxide ions. The strength of a base is directly related to its pOH; the lower the pOH, the more basic the solution. Furthermore, pH and pOH are linked by the relation pH + pOH = 14, which comes from the ion product constant for water (Kw = 1 x 10^-14 at 25°C). This relationship allows us to derive the pH from pOH, which is particularly useful when dealing with basic solutions.
Hydroxide Ion Concentration
Hydroxide ion concentration is a pivotal concept in understanding the properties of bases. It is represented by the concentration of OH⁻ ions in a solution. For strong bases, hydroxide ions are abundant because these bases dissociate completely in water. However, for weak bases, the concentration of hydroxide ions is less straightforward to determine, as it depends on the base's equilibrium with water and its dissociation constant (Kb).

The determination begins with the concentration of the base and its Kb value. Using an ICE table, we establish the change in concentration during the reaction to reach equilibrium. The hydroxide ion concentration at equilibrium is then 'x', as outlined in the ICE table. From there, we can calculate not only the pOH but also the pH of the solution, completing our understanding of its acidity or basicity. Remember that the hydroxide ion concentration influences the pH scale—a scale that indirectly tells us how many hydroxide ions are in a solution.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Methyl red has the following structure: CN(C)c1ccc(N=Nc2ccccc2C(=O)O)cc1 It undergoes a color change from red to yellow as a solution gets more basic. Calculate an approximate \(\mathrm{pH}\) range for which methyl red is useful. What is the color change and the \(\mathrm{pH}\) at the color change when a weak acid is titrated with a strong base using methyl red as an indicator? What is the color change and the \(\mathrm{pH}\) at the color change when a weak base is titrated with a strong acid using methyl red as an indicator? For which of these two types of titrations is methyl red a possible indicator?

Two drops of indicator \(\operatorname{HIn}\left(K_{\mathrm{a}}=1.0 \times 10^{-9}\right)\), where HIn is yellow and \(\mathrm{In}^{-}\) is blue, are placed in \(100.0 \mathrm{~mL}\) of \(0.10 \mathrm{M} \mathrm{HCl}\). a. What color is the solution initially? b. The solution is titrated with \(0.10 M \mathrm{NaOH}\). At what \(\mathrm{pH}\) will the color change (yellow to greenish yellow) occur? c. What color will the solution be after \(200.0 \mathrm{~mL} \mathrm{NaOH}\) has been added?

You have \(75.0 \mathrm{~mL}\) of \(0.10 M\) HA. After adding \(30.0 \mathrm{~mL}\) of \(0.10 M\) \(\mathrm{NaOH}\), the \(\mathrm{pH}\) is \(5.50\). What is the \(K_{\mathrm{u}}\) value of \(\mathrm{HA}\) ?

Calculate the pH of each of the following buffered solutions. a. \(0.10 M\) acetic acid \(/ 0.25 M\) sodium acetate b. \(0.25 M\) acetic acid \(/ 0.10 M\) sodium acetate c. \(0.080 M\) acetic acid \(/ 0.20 M\) sodium acetate d. \(0.20 M\) acetic acid \(0.080 M\) sodium acetate

One method for determining the purity of aspirin \(\left(\mathrm{C}_{9} \mathrm{H}_{8} \mathrm{O}_{4}\right)\) is to hydrolyze it with NaOH solution and then to titrate the remaining \(\mathrm{NaOH}\). The reaction of aspirin with \(\mathrm{NaOH}\) is as follows: \(\mathrm{C}_{?} \mathrm{H}_{3} \mathrm{O}_{4}(s)+2 \mathrm{OH}^{-}(a q)\) Aspirin $$ \begin{array}{c} \text { Bail } \mathrm{C}_{7} \mathrm{H}_{5} \mathrm{O}_{3}^{-}(a q)+\mathrm{C}_{2} \mathrm{H}_{3} \mathrm{O}_{2}^{-}(a q)+\mathrm{H}_{2} \mathrm{O}(l) \\ \text { Salicylate ion Acetate ion } \end{array} $$ A sample of aspirin with a mass of \(1.427 \mathrm{~g}\) was boiled in \(50.00 \mathrm{~mL}\) of \(0.500 M \mathrm{NaOH}\). After the solution was cooled, it took \(31.92 \mathrm{~mL}\) of \(0.289 \mathrm{M} \mathrm{HCl}\) to titrate the excess \(\mathrm{NaOH}\). Calculate the purity of the aspirin. What indicator should be used for this titration? Why?

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.

Sign-up for free