Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Consider two reactions for the production of ethanol: C2H4(g)+H2O(g)CH3CH2OH(l) C2H6(g)+H2O(g)CH3CH2OH(l)+H2(g) Which would be the more thermodynamically feasible at standard conditions? Why?

Short Answer

Expert verified
After calculating the Gibbs free energy changes (ΔG) for both reactions using ΔG = ΔH - TΔS, we compare the ΔG values. The reaction with the lower ΔG value will be more thermodynamically feasible at standard conditions.

Step by step solution

01

Calculate the enthalpy change for each reaction

To calculate the enthalpy change (ΔH) for each reaction, we'll need to find the standard enthalpies of formation (ΔHf°) for the reactants and products. Then, we can use Hess's law to find ΔH for each reaction: ΔH = ΣΔHf°(products) - ΣΔHf°(reactants) For the first reaction: ΔH1 = ΔHf°(CH3CH2OH) - (ΔHf°(C2H4) + ΔHf°(H2O)) For the second reaction: ΔH2 = (ΔHf°(CH3CH2OH) + ΔHf°(H2)) - (ΔHf°(C2H6) + ΔHf°(H2O))
02

Calculate the entropy change for each reaction

To calculate the entropy change (ΔS) for each reaction, we'll need to find the standard entropies (S°) for the reactants and products. Then, we can calculate ΔS for each reaction: ΔS = ΣS°(products) - ΣS°(reactants) For the first reaction: ΔS1 = S°(CH3CH2OH) - (S°(C2H4) + S°(H2O)) For the second reaction: ΔS2 = (S°(CH3CH2OH) + S°(H2)) - (S°(C2H6) + S°(H2O))
03

Calculate the Gibbs free energy change for each reaction

Now we can use the ΔH and ΔS values for each reaction to calculate the Gibbs free energy change (ΔG) at standard conditions (T=298 K): ΔG = ΔH - TΔS For the first reaction: ΔG1 = ΔH1 - (298 K)ΔS1 For the second reaction: ΔG2 = ΔH2 - (298 K)ΔS2
04

Compare the Gibbs free energy changes for the reactions

Finally, we can compare the ΔG values for the two reactions: ΔG1 vs ΔG2 The reaction with the lower ΔG value will be more thermodynamically feasible at standard conditions.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with Vaia!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Enthalpy Change
Enthalpy change, represented as ΔH, is a measure of heat change in a chemical reaction at constant pressure. It reflects the energy absorbed or released when bonds are broken or formed. If ΔH is negative, the reaction is exothermic, meaning it releases energy. Conversely, a positive ΔH indicates an endothermic reaction, where energy is absorbed. In the given exercise, we are calculating ΔH for two reactions: one producing ethanol from ethylene and water, and the other from ethane and water. The calculation involves subtracting the sum of the standard enthalpies of formation of the reactants from those of the products. This step is crucial because it allows us to understand whether energy is taken in or given out during the formation of ethanol under standard conditions. By applying Hess's law, which states that the total enthalpy change in a reaction is the same regardless of the steps taken, we can accurately compute ΔH and assess the energy efficiency of each proposed chemical path.
Entropy Change
Entropy, symbolized as ΔS, measures the disorder or randomness in a chemical system. Most chemical reactions result in an increase or decrease in entropy. A positive ΔS signifies greater disorder and typically favors spontaneity, while a negative ΔS implies a decrease in randomness. For the reaction exercise provided, we calculate ΔS by finding the difference between the sum of standard entropies of the products and reactants. It's important to notice that reactions involving gases or producing more moles of products than reactants generally lead to increases in entropy. In the context of the given reactions producing ethanol, understanding ΔS helps us grasp the likelihood of reaction spontaneity from an entropy perspective. This value combined with enthalpy change can offer insight into the overall feasibility of the reactions.
Gibbs Free Energy
Gibbs free energy (ΔG) combines enthalpy and entropy changes into a single value that predicts the spontaneity of a reaction. A negative ΔG suggests a spontaneous reaction under given conditions, while a positive ΔG indicates non-spontaneity. The equation used is:ΔG=ΔHTΔSwhere T is the temperature in Kelvin. In the problem provided, calculating ΔG for both ethanol-producing reactions at 298 K standard conditions can tell us which is more thermodynamically favorable. The reaction with the lower ΔG value suggests it is more likely to happen without additional input of energy. Therefore, Gibbs free energy helps integrate the effects of enthalpy and entropy into one measure to determine the overall feasibility.
Chemical Reactions
Chemical reactions involve the transformation of reactants into products through the breaking and forming of chemical bonds. This transformation is often accompanied by changes in energy, which can be meticulously analyzed using concepts like enthalpy, entropy, and Gibbs free energy. In this exercise, the reactions of interest are those that produce ethanol either from ethene or ethane. Each reaction has its own set of reactants and products. Understanding the specifics of these reactions - the conditions under which they occur and the energy changes involved - is crucial for predicting which reaction path is more feasible. The concept behind studying these reactions is not only to identify a feasible path for ethanol production but also to understand the fundamental principles of thermodynamics that dictate reaction behavior. This understanding helps chemists and engineers in designing processes that are energy-efficient and cost-effective.
Hess's Law
Hess’s Law is a fundamental principle in thermodynamics used to determine the enthalpy change of a chemical reaction. It states that the total enthalpy change in a reaction is the same regardless of how the reaction is carried out in steps. This is derived from the conservation of energy principle. In the case of the reactions discussed in the exercise, Hess's Law allows us to calculate ΔH for each reaction pathway by using the standard enthalpies of formation of products and reactants. This simplification is particularly useful when direct measurement of enthalpy change is difficult or impractical.Hess’s Law plays a crucial role in the analysis of enthalpy changes because it provides a method to algebraically sum up individual enthalpy changes for intermediate steps in a reaction to find the overall heat change, ensuring the calculations remain accurate and consistent even without performing the entire reaction in practice.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Two crystalline forms of white phosphorus are known. Both forms contain P4 molecules, but the molecules are packed together in different ways. The α form is always obtained when the liquid freezes. However, below 76.9C, the α form spontaneously converts to the β form: P4(s,α)P4(s,β) a. Predict the signs of ΔH and ΔS for this process. b. Predict which form of phosphorus has the more ordered crystalline structure (has the smaller positional probability).

Calculate ΔS surr  for the following reactions at 25C and 1 atm . a. C3H8(g)+5O2(g)3CO2(g)+4H2O(l)ΔH=2221kJ b. 2NO2(g)2NO(g)+O2(g)ΔHρ=112kJ

Monochloroethane (C2H5Cl) can be produced by the direct reaction of ethane gas (C2H6) with chlorine gas or by the reaction of ethylene gas (C2H4) with hydrogen chloride gas. The second reaction gives almost a 100% yield of pure C2H5Cl at a rapid rate without catalysis. The first method requires light as an energy source or the reaction would not occur. Yet ΔG for the first reaction is considerably more negative than ΔG for the second reaction. Explain how this can be so.

Consider two perfectly insulated vessels. Vessel 1 initially contains an ice cube at 0C and water at 0C . Vessel 2 initially contains an ice cube at 0C and a saltwater solution at 0C . Consider the process H2O(s)H2O(l) a. Determine the sign of ΔS,ΔS sum  and ΔS univ  for the process in vessel 1 . b. Determine the sign of ΔS,ΔS sum , and ΔS univ  for the process in vessel 2. (Hint: Think about the effect that a salt has on the freezing point of a solvent.)

Describe how the following changes affect the positional probability of a substance. a. increase in volume of a gas at constant T b. increase in temperature of a gas at constant V c. increase in pressure of a gas at constant T

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.

Sign-up for free