Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Q63E

Page 83

The reaction of an element X with element Y is represented in the following diagram. Which ofthe equations best describes this reaction?

a. 3X + 8Y → X3Y8
b. 3X + 6Y → X3Y6
c. X + 2Y → XY2
d. 3X + 8Y → 3XY2 + 2Y

Q64E

Page 83

Silicon is produced for the chemical and electronics industries by the following reactions. Givethe balanced equation for each reaction.
a. SiO2(s) + C(s) → Si2(s) + CO(g)
b. Silicon tetrachloride is reacted with very pure magnesium, producing silicon and magnesium chloride.
c. Na SiF6(s) + Na(s) —Si(s) + NaF(s)

Q65

Page 83

Give the balanced equation for each of the following chemical reactions

a.GlucoseC6H12O6reacts with oxygen gas to produce gaseous carbon dioxide and water vapour.

b. Solid ironIII sulfide reacts with gaseous hydrogen chloride to form solid ironIII chloride and hydrogen sulfide gas.

c. Carbon disulfide liquid reacts with ammonia gas to produce hydrogen sulphide gas and solid ammonium thiocyanateNH4SCN .

Q66

Page 83

Iron oxide ores, commonly a mixture ofFeOand Fe2O3are given the general formula Fe3O4.
They yield elemental iron when heated to a very high temperature with either carbon monoxideor elemental hydrogen. Balance the following equations for these processes:

Fe3O4s+H2gFes+H2Og

Fe3O4s+COgFes+CO2g

Q67

Page 83

Balance the following equations representing combusting reactions:

c. C12H22O11(s)+O2(g)CO2(g)+H2O(g)

d. Fes+O2gFe2O3s

e.FeOs+O2gFe2O3s

Q68

Page 83

Give the balanced equation for each of the following.
a. The combustion of ethanolC2H5OHforms carbon dioxide and water vapor. A combustion reaction refers to a reaction of a substance with oxygen gas.
b. Aqueous solutions of leadIInitrate and sodium phosphate are mixed, resulting in the precipitate formation of leadIIphosphate with aqueous sodium nitrate as the other product.

Q69

Page 83

Balance the given equations.

  1. Crs+S8sCr2S3s
  2. NaHCO3sHeatNa2CO3s+CO2g+H2Og
  3. KClO3sHeatKCls+O2g
  4. Eus+HFgEuF3s+H2g

Q70

Page 83

Balance each of the following chemical equations.

  1. KO2s+H2OlKOHaq+O2g+H2O2aq
  2. Fe2O3s+HNO3aqFeNO33aq+H2Ol
  3. NH3g+O2gNOg+H2Og
  4. PCl5l+H2OlH3PO4aq+HClg
  5. CaOs+CsCaC2s+CO2g
  6. MoS2s+O2gMoO3s+SO2g

Q71E

Page 83

The reusable booster rockets of the U.S. space shuttle use a mixture of aluminium andammonium per chlorate for fuel. A possible equation for this reaction is
3Als+3NH4ClO4sAl2O3s+AlCl3s+3NOg+6H2Og
what mass ofNH4ClO4should be used in the fuel mixture for every kilogram of?

Q72

Page 83

One of relatively few reactions that take place directly between two solids at room temperatureis

BaOH2·8H2Os+NH4SCNsBaSCN2s+H2Ol+NH3g

In this equation, the localid="1662172238669" 8H2OinBaOH2·8H2Osindicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate.
a. Balance the equation.
b. What mass of ammonium thiocyanate (NH4SCN)must be used if it is to react completely with 6.5gbarium hydroxide octahydrate?

Access millions of textbook solutions in one place

  • Access over 3 million high quality textbook solutions
  • Access our popular flashcard, quiz, mock-exam and notes features
  • Access our smart AI features to upgrade your learning
Get Vaia Premium now
Access millions of textbook solutions in one place

Recommended explanations on Chemistry Textbooks