Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Q94AE

Page 435

Consider the following electrochemical cell:

a. If silver metal is a product of the reaction, is the cella galvanic cell or electrolytic cell? Label the cathodeand anode, and describe the direction of the electronflow.

b. If copper metal is a product of the reaction, is thecell a galvanic cell or electrolytic cell? Label thecathode and anode, and describe the direction of theelectron flow.

c. If the cell is a galvanic cell, determine the standardcell potential.

d. If the cell is electrolytic, determine the minimumexternal potential needed to cause the reactionto occur.

Q96AE

Page 435

In theory, most metals should easily corrode in air. Why?

A group of metals called noble metals is relatively difficult to corrode in the air. Some noble metals include gold, platinum, and silver. Reference Table 11.1 to come up with a possible reason why the noble metals are relatively difficult to corrode.

Q97AE

Page 435

An experimental fuel cell has been designed that uses carbon monoxide as fuel. The overall reaction is

2CO(g)+O2(g)2CO2(g)

The two half-cell reactions are

CO+O2-CO2+2e-O2+4e-2O2-

The two half-reactions are carried out in separate compartments connected with a solid mixture of CeO2 and Gd2O3. Oxide ions can move through this solid at high temperatures (about 800°C). ∆Gfor the overall reaction at 800°C under certain concentration conditions is -380 kJ. Calculate the cell potential for this fuel cell at the same temperature and concentration conditions.

Q98AE

Page 435

Batteries are galvanic cells. What happens to Ecell as a battery discharge? Does a battery represent a system at equilibrium? Explain. What is Ecellwhen a battery reaches equilibrium? How are batteries and fuel cells a like? How are they different? The U.S. space program uses hydrogen-oxygen fuel cells to produce power for its space craft. What is a hydrogen-oxygen fuel cell?

Q99AE

Page 435

A fuel cell designed to react grain alcohol with oxygen has the following net reaction:

C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)

The maximum work 1 mole of alcohol can yield by this process is 1320 kJ. What is the theoretical maximum voltage this cell can achieve?

Q9DQ

Page 435

Explain why cell potentials are not multiplied by the coefficients in the balanced equation. (Hint: Use the relationship between DG and cell potential.)

Access millions of textbook solutions in one place

  • Access over 3 million high quality textbook solutions
  • Access our popular flashcard, quiz, mock-exam and notes features
  • Access our smart AI features to upgrade your learning
Get Vaia Premium now
Access millions of textbook solutions in one place

Recommended explanations on Chemistry Textbooks