Warning: foreach() argument must be of type array|object, bool given in /var/www/html/web/app/themes/studypress-core-theme/template-parts/header/mobile-offcanvas.php on line 20

Chapter 7: Chemical Quantities and Reactions

Q. 7.59

Page 245

Sodium reacts with oxygen to produce sodium oxide.

a. How many grams of Na2Oare produced when 57.5gof Nareacts?

b. If you have 18.0gof Na, how many grams of O2are needed for the reaction?

c. How many grams ofO2are needed in a reaction that produces75.0gofNa2O?

Q. 7.6

Page 220

Calculate each of the following quantities in 0.185moles of C6H14O:

  1. moles ofC
  2. moles ofO
  3. atoms of H
  4. atoms of C

Q. 7.60

Page 245

Nitrogen gas reacts with hydrogen gas to produce ammonia.

N2(g) + 3H2(g) 2NH3(g)

(a) If you have 3.64g of H, how many grams of NH3can be

produced?

(b) How many grams of H, are needed to react with 2.80g

of N?

(c) How many grams of NH3can be produced from 12.0g

of H?

Q. 7.61

Page 245

Ammonia and oxygen react to form nitrogen and water.

4NH3(g)+3O2(g)2N2(g)+6H2O(g)

a. How many grams of O2are needed to react withlocalid="1653487157133" 13.6gof NH3?

b. How many grams of N2can be produced whenlocalid="1653487174328" 6.50gof O2reacts?

c. How many grams of H2Oare formed from the reaction of localid="1653487189643" 34.0gofNH3?

Q. 7.62

Page 245

Iron(III) oxide reacts with carbon to give iron and carbon monoxide.

Fe2O3(s)+3C(s)2Fe(s)+3CO(g)

a. How many grams of Care required to react with localid="1653488683706" 16.5gof Fe2O3?

b. How many grams of COare produced whenlocalid="1653488713236" 36.0gof Creacts ?

c. How many grams of Fe can be produced when localid="1653488730008" 6.00gof Fe2O3reacts?

Q. 7.63

Page 246

Nitrogen dioxide and water react to produce nitric acid, HNO3and nitrogen oxide.

3NO2(g)+H2O(l)2HNO3(aq)+NO(g)

a. How many grams of H2Oare needed to react with localid="1653489937778" 28.0gof NO2?

b. How many grams of NOare produced from localid="1653489953268" 15.8gof H2O?

c. How many grams of HNO3are produced fromlocalid="1653489964665" 8.25gof NO2?

Q. 7.64

Page 246

Calcium cyanamide, CaCN2reacts with water to form calcium carbonate and ammonia.

CaCN2(s)+3H2O(l)CaCO3(s)+2NH3(g)

a. How many grams of H2Oare needed to react with localid="1653494390919" 75.0gof CaCN2?

b. How many grams ofNH3are produced from localid="1653494416163" 5.24gof CaCN2?

c. How many grams of CaCO3form iflocalid="1653494442688" 155gof H2Oreacts?

Q. 7.65

Page 246

When solid lead(II) sulfide reacts with oxygen gas, the products are solid lead(II) oxide and sulfur dioxide gas.

a. Write the balanced chemical equation for the reaction.

b. How many grams of oxygen are required to react with 29.9gof lead(II) sulfide?

c. How many grams of sulfur dioxide can be produced when 65.0gof lead(II) sulfide reacts?

d. How many grams of lead(II) sulfide are used to produce128gof lead(II) oxide?

Q. 7.66

Page 246

When the gases dihydrogen sulfide and oxygen react, they form the gases sulfur dioxide and water vapor.

a. Write the balanced chemical equation for the reaction.

b. How many grams of oxygen are needed to react with 2.50gof dihydrogen sulfide?

c. How many grams of sulfur dioxide can be produced when 38.5gof oxygen reacts?

d. How many grams of oxygen are needed to produce55.8gof water vapor?

Q. 7.67

Page 249

a. Why do chemical reactions require energy of activation ?

b. In an exothermic reaction, is the energy of the products higher or lower than that of the reactants?

c. Draw an energy diagram for an exothermic reaction.

Access millions of textbook solutions in one place

  • Access over 3 million high quality textbook solutions
  • Access our popular flashcard, quiz, mock-exam and notes features
  • Access our smart AI features to upgrade your learning
Get Vaia Premium now
Access millions of textbook solutions in one place

Recommended explanations on Chemistry Textbooks